5-Bromo-7-nitro-1H-indazole structure
|
Common Name | 5-Bromo-7-nitro-1H-indazole | ||
|---|---|---|---|---|
| CAS Number | 316810-82-9 | Molecular Weight | 242.030 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | 420.8±25.0 °C at 760 mmHg | |
| Molecular Formula | C7H4BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.3±23.2 °C | |
| Name | 5-Bromo-7-nitro-1H-indazole |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 420.8±25.0 °C at 760 mmHg |
| Molecular Formula | C7H4BrN3O2 |
| Molecular Weight | 242.030 |
| Flash Point | 208.3±23.2 °C |
| Exact Mass | 240.948685 |
| PSA | 74.50000 |
| LogP | 2.03 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.764 |
| InChIKey | UBGVVAXTJXNHFX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Br)cc2cn[nH]c12 |
| HS Code | 2933990090 |
|---|
|
~62%
5-Bromo-7-nitro... CAS#:316810-82-9 |
| Literature: Rakib; Benchidmi; Essassi; El Bouadili; Ibn Mansour; Bellan; Lopez; Lamande Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2000 , vol. 39, # 5 p. 339 - 345 |
|
~%
5-Bromo-7-nitro... CAS#:316810-82-9 |
| Literature: Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, , vol. 39, # 5 p. 339 - 345 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Bromo-7-nitro-1H-indazole |
| 5-Bromo-7-nitro 1H-indazole |
| 1H-Indazole, 5-bromo-7-nitro- |