2-pyridin-4-yl-3h-benzoimidazole-5-carboxylic acid structure
|
Common Name | 2-pyridin-4-yl-3h-benzoimidazole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 316833-32-6 | Molecular Weight | 239.22900 | |
| Density | 1.439g/cm3 | Boiling Point | 575.2ºC at 760mmHg | |
| Molecular Formula | C13H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.6ºC | |
| Name | 2-pyridin-4-yl-3H-benzimidazole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.439g/cm3 |
|---|---|
| Boiling Point | 575.2ºC at 760mmHg |
| Molecular Formula | C13H9N3O2 |
| Molecular Weight | 239.22900 |
| Flash Point | 301.6ºC |
| Exact Mass | 239.06900 |
| PSA | 78.87000 |
| LogP | 2.32310 |
| Index of Refraction | 1.728 |
| InChIKey | TYFICRRCLJYFJU-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2nc(-c3ccncc3)[nH]c2c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~%
2-pyridin-4-yl-... CAS#:316833-32-6 |
| Literature: Wubulikasimu, Reyila; Yang, Yanbing; Xue, Fei; Luo, Xianjin; Shao, Dongping; Li, Yuhuan; Gao, Rongmei; Ye, Weidong Bulletin of the Korean Chemical Society, 2013 , vol. 34, # 8 p. 2297 - 2304 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| GL-0329 |
| 2-pyridin-4-yl-1H-benzimidazole-5-carboxylic acid |