Glycine, L-g-glutamyl-S-[(4-bromophenyl)methyl]-L-cysteinyl- structure
|
Common Name | Glycine, L-g-glutamyl-S-[(4-bromophenyl)methyl]-L-cysteinyl- | ||
|---|---|---|---|---|
| CAS Number | 31702-37-1 | Molecular Weight | 476.34200 | |
| Density | 1.554g/cm3 | Boiling Point | 837.7ºC at 760mmHg | |
| Molecular Formula | C17H22BrN3O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 460.4ºC | |
| Name | (2S)-2-amino-5-[[(2R)-3-[(4-bromophenyl)methylsulfanyl]-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.554g/cm3 |
|---|---|
| Boiling Point | 837.7ºC at 760mmHg |
| Molecular Formula | C17H22BrN3O6S |
| Molecular Weight | 476.34200 |
| Flash Point | 460.4ºC |
| Exact Mass | 475.04100 |
| PSA | 184.12000 |
| LogP | 2.04210 |
| Index of Refraction | 1.615 |
| InChIKey | HMNYAPVDRLKBJH-UHFFFAOYSA-N |
| SMILES | NC(CCC(=O)NC(CSCc1ccc(Br)cc1)C(=O)NCC(=O)O)C(=O)O |
|
~%
Glycine, L-g-gl... CAS#:31702-37-1 |
| Literature: Stekol Journal of Biological Chemistry, 1941 , vol. 138, p. 225,226 |
|
~%
Glycine, L-g-gl... CAS#:31702-37-1 |
| Literature: Vince; Daluge Journal of medicinal chemistry, 1971 , vol. 14, # 1 p. 35 - 37 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| S-p-bromobenzylglutathione |