Benzenamine,2-nitro-N-(triphenylphosphoranylidene)- structure
|
Common Name | Benzenamine,2-nitro-N-(triphenylphosphoranylidene)- | ||
|---|---|---|---|---|
| CAS Number | 31706-27-1 | Molecular Weight | 398.39400 | |
| Density | 1.18g/cm3 | Boiling Point | 572.1ºC at 760mmHg | |
| Molecular Formula | C24H19N2O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.8ºC | |
| Name | (2-nitrophenyl)imino-triphenyl-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 572.1ºC at 760mmHg |
| Molecular Formula | C24H19N2O2P |
| Molecular Weight | 398.39400 |
| Flash Point | 299.8ºC |
| Exact Mass | 398.11800 |
| PSA | 67.99000 |
| LogP | 5.92720 |
| Index of Refraction | 1.625 |
| InChIKey | HTSFZNJWVHYJFV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1N=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
|
~%
Benzenamine,2-n... CAS#:31706-27-1 |
| Literature: Horner; Oediger Justus Liebigs Annalen der Chemie, 1959 , vol. 627, p. 142,147 |
|
~%
Benzenamine,2-n... CAS#:31706-27-1 |
| Literature: Cadogan,J.I.G. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1974 , p. 1694 - 1702 |
| 2-nitro-N-triphenylphosphoranyliden-aniline |
| o-Nitrophenyl-iminotriphenylphosphoran |