3-(phenoxymethyl)benzoic acid structure
|
Common Name | 3-(phenoxymethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 31719-75-2 | Molecular Weight | 228.24300 | |
| Density | 1.222g/cm3 | Boiling Point | 409.2ºC at 760mmHg | |
| Molecular Formula | C14H12O3 | Melting Point | 118ºC | |
| MSDS | N/A | Flash Point | 158.1ºC | |
| Name | 3-(phenoxymethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 409.2ºC at 760mmHg |
| Melting Point | 118ºC |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.24300 |
| Flash Point | 158.1ºC |
| Exact Mass | 228.07900 |
| PSA | 46.53000 |
| LogP | 2.96380 |
| Index of Refraction | 1.605 |
| InChIKey | URLYREZIPSJJQU-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(COc2ccccc2)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Inhibition of recombinant Mycobacterium tuberculosis DHFR expressed in Escherichia co...
Source: ChEMBL
Target: Dihydrofolate reductase
External Id: CHEMBL4625598
|
| 3-Phenoxymethyl-benzoesaeure |
| 3-phenoxymethyl-benzoic acid |