Enpiprazole
Modify Date: 2025-08-31 15:01:09
Enpiprazole structure
|
Common Name | Enpiprazole | ||
|---|---|---|---|---|
| CAS Number | 31729-24-5 | Molecular Weight | 304.81800 | |
| Density | 1.21g/cm3 | Boiling Point | 445.2ºC at 760mmHg | |
| Molecular Formula | C16H21ClN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223ºC | |
| Name | Enpiprazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 445.2ºC at 760mmHg |
| Molecular Formula | C16H21ClN4 |
| Molecular Weight | 304.81800 |
| Flash Point | 223ºC |
| Exact Mass | 304.14500 |
| PSA | 24.30000 |
| LogP | 2.44110 |
| Index of Refraction | 1.62 |
| InChIKey | WBFVWQJVMMIQFI-UHFFFAOYSA-N |
| SMILES | Cn1cc(CCN2CCN(c3ccccc3Cl)CC2)cn1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(2-Chlorophenyl)-4-[2-(1-methyl-1H-pyrazol-4-yl)ethyl]piperazine |
| H-3608 |