5-(Chloromethyl)-2-(4-chlorophenyl)-4-methylthiazole structure
|
Common Name | 5-(Chloromethyl)-2-(4-chlorophenyl)-4-methylthiazole | ||
|---|---|---|---|---|
| CAS Number | 317319-28-1 | Molecular Weight | 258.16700 | |
| Density | 1.335g/cm3 | Boiling Point | 389.7ºC at 760mmHg | |
| Molecular Formula | C11H9Cl2NS | Melting Point | 109-112ºC | |
| MSDS | N/A | Flash Point | 189.5ºC | |
| Name | 5-(Chloromethyl)-2-(4-chlorophenyl)-4-methyl-1,3-thiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.335g/cm3 |
|---|---|
| Boiling Point | 389.7ºC at 760mmHg |
| Melting Point | 109-112ºC |
| Molecular Formula | C11H9Cl2NS |
| Molecular Weight | 258.16700 |
| Flash Point | 189.5ºC |
| Exact Mass | 256.98300 |
| PSA | 41.13000 |
| LogP | 4.51070 |
| Index of Refraction | 1.607 |
| InChIKey | GZXHFIJLAGIXIN-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2ccc(Cl)cc2)sc1CCl |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934100090 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-(chloromethyl)-4-methyl-2-(4-chlorophenyl)thiazole |
| 5-chloromethyl-2-(4-chlorophenyl)-4-methylthiazole |
| chloromethylchlorophenylmethylthiazole |