7-NITRO-1,2-DIHYDRO-3H-INDAZOL-3-ON
Modify Date: 2026-08-06 11:49:27
7-NITRO-1,2-DIHYDRO-3H-INDAZOL-3-ON structure
|
Common Name | 7-NITRO-1,2-DIHYDRO-3H-INDAZOL-3-ON | ||
|---|---|---|---|---|
| CAS Number | 31775-97-0 | Molecular Weight | 179.13300 | |
| Density | 1.506g/cm3 | Boiling Point | 284.8ºC at 760mmHg | |
| Molecular Formula | C7H5N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.1ºC | |
| Name | 7-nitro-1,2-dihydroindazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.506g/cm3 |
|---|---|
| Boiling Point | 284.8ºC at 760mmHg |
| Molecular Formula | C7H5N3O3 |
| Molecular Weight | 179.13300 |
| Flash Point | 126.1ºC |
| Exact Mass | 179.03300 |
| PSA | 94.47000 |
| LogP | 1.28760 |
| Index of Refraction | 1.634 |
| InChIKey | DIMKMDUVYPSCLV-UHFFFAOYSA-N |
| SMILES | O=c1[nH][nH]c2c([N+](=O)[O-])cccc12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
|
~%
7-NITRO-1,2-DIH... CAS#:31775-97-0 |
| Literature: Kenner; Witham Journal of the Chemical Society, 1921 , vol. 119, p. 1057 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Inhibition of iNOS in LPS-stimulated Wistar rat lung assessed as inhibition of [3H]L-...
Source: ChEMBL
Target: Nitric oxide synthase, inducible
External Id: CHEMBL1762844
|
|
Name: Inhibition of nNOS in LPS-stimulated Wistar rat striata assessed as inhibition of [3H...
Source: ChEMBL
Target: Nitric oxide synthase, brain
External Id: CHEMBL1762845
|
Total 2, Current Page 1 of 1
1
| 7-nitro-1,2-dihydro-indazol-3-one |
| 7-nitro-indazolin-3-one |
| 7-nitro-1H-2-hydroindazol-3-one |
| 7-Nitro-1,2-dihydro-indazol-3-on |