N-[1-[bis(2-chloroethyl)carbamoyl]-2-phenyl-ethyl]benzamide structure
|
Common Name | N-[1-[bis(2-chloroethyl)carbamoyl]-2-phenyl-ethyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 3183-30-0 | Molecular Weight | 393.30700 | |
| Density | 1.24g/cm3 | Boiling Point | 619.2ºC at 760 mmHg | |
| Molecular Formula | C20H22Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 328.3ºC | |
| Name | N-[1-[bis(2-chloroethyl)amino]-1-oxo-3-phenylpropan-2-yl]benzamide |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 619.2ºC at 760 mmHg |
| Molecular Formula | C20H22Cl2N2O2 |
| Molecular Weight | 393.30700 |
| Flash Point | 328.3ºC |
| Exact Mass | 392.10600 |
| PSA | 49.41000 |
| LogP | 3.72480 |
| Index of Refraction | 1.58 |
| InChIKey | ZJHRRBJLUJRPOA-UHFFFAOYSA-N |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)N(CCCl)CCCl)c1ccccc1 |
|
~%
N-[1-[bis(2-chl... CAS#:3183-30-0 |
| Literature: Levi,I. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 715 - 718 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |