N-Benzoyl-L-phenylalanine
N-Benzoyl-L-phenylalanine structure
|
Common Name | N-Benzoyl-L-phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 2566-22-5 | Molecular Weight | 269.29 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 496.6±38.0 °C at 760 mmHg | |
| Molecular Formula | C16H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.1±26.8 °C | |
Use of N-Benzoyl-L-phenylalanineBenzoylphenylalanine is a photoaffinity label. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | bz-phe-oh |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 496.6±38.0 °C at 760 mmHg |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.29 |
| Flash Point | 254.1±26.8 °C |
| Exact Mass | 269.10519334 |
| PSA | 66.40000 |
| LogP | 2.81 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | NPKISZUVEBESJI-AWEZNQCLSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)C2=CC=CC=C2 |
| Storage condition | Store at RT. |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn,Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . R42/43:May cause sensitization by inhalation and skin contact . |
| Safety Phrases | S26-S36 |
| WGK Germany | 2 |
| RTECS | XI0372200 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 10 | |
CAS#:63-91-2
CAS#:98-88-4
CAS#:26348-47-0
CAS#:57427-85-7
CAS#:93-58-3
CAS#:67-56-1
CAS#:5874-61-3
CAS#:1155-48-2
CAS#:3278-14-6
CAS#:17350-84-4
CAS#:2134-24-9
CAS#:21709-69-3
CAS#:673-06-3
CAS#:23239-35-2
CAS#:842-74-0![N-[1-[bis(2-chloroethyl)carbamoyl]-2-phenyl-ethyl]benzamide structure](https://image.chemsrc.com/caspic/036/3183-30-0.png)
CAS#:3183-30-0This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| BZO-PHE-OH |
| benzoylphenylalanine |
| N-BENZOYL-L-PHENYLALANINE |
| MFCD00063153 |
| L-Phenylalanine,N-benzoyl |
| Methyl N-benzoyl-L-phenylalaninate |
| (S)-2-benzamido-3-phenylpropanoic acid |
| N-Benzoylphenylalanine |
| Bz-L-Phe-OH |
| BENZOYL-PHE-OH |
| BZ-PHENYLALANINE |
| N-benzoyl-D,L-phenylalanine |
| N-benzoyl-L-Phe |
| BENZOYL-L-PHENYLALANINE |
| L-Phenylalanine, N-benzoyl-, methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of bz-phe-oh? |
| A: CAS number of bz-phe-oh is 2566-22-5. |
| Q: What is the LogP of bz-phe-oh? |
| A: LogP of bz-phe-oh is 2.81. |
| Q: What is the molecular weight of bz-phe-oh? |
| A: Molecular weight of bz-phe-oh is 269.29. |
| Q: What is the molecular formula of bz-phe-oh? |
| A: Molecular formula of bz-phe-oh is C16H15NO3. |
| Q: What is the SMILES notation of bz-phe-oh? |
| A: SMILES notation of bz-phe-oh is C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)C2=CC=CC=C2. |
| Q: What is the InChIKey of bz-phe-oh? |
| A: InChIKey of bz-phe-oh is NPKISZUVEBESJI-AWEZNQCLSA-N. |
| Q: What are the uses of bz-phe-oh? |
| A: Main uses of bz-phe-oh: Benzoylphenylalanine is a photoaffinity label. |
| Q: What is the English name of bz-phe-oh? |
| A: The English name of bz-phe-oh is bz-phe-oh. |
| Q: What is the polar surface area (PSA) of bz-phe-oh? |
| A: Polar surface area (PSA) of bz-phe-oh is 66.40000. |
| Q: What is the boiling point of bz-phe-oh? |
| A: Boiling point of bz-phe-oh is 496.6±38.0 °C at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |