[1-Methyl-5-phenoxy-3-(trifluoromethyl)-1H-pyrazol-4-yl]methanol 97 structure
|
Common Name | [1-Methyl-5-phenoxy-3-(trifluoromethyl)-1H-pyrazol-4-yl]methanol 97 | ||
|---|---|---|---|---|
| CAS Number | 318469-22-6 | Molecular Weight | 272.22300 | |
| Density | 1.35g/cm3 | Boiling Point | 338.9ºC at 760 mmHg | |
| Molecular Formula | C12H11F3N2O2 | Melting Point | 80-82ºC | |
| MSDS | N/A | Flash Point | 158.8ºC | |
| Name | [1-methyl-5-phenoxy-3-(trifluoromethyl)pyrazol-4-yl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 338.9ºC at 760 mmHg |
| Melting Point | 80-82ºC |
| Molecular Formula | C12H11F3N2O2 |
| Molecular Weight | 272.22300 |
| Flash Point | 158.8ºC |
| Exact Mass | 272.07700 |
| PSA | 47.28000 |
| LogP | 2.72350 |
| Index of Refraction | 1.527 |
| InChIKey | TVYDMZWMEOZWHY-UHFFFAOYSA-N |
| SMILES | Cn1nc(C(F)(F)F)c(CO)c1Oc1ccccc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933199090 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(Hydroxymethyl)-1-methyl-5-phenoxy-3-(trifluoromethyl)-1H-pyrazole |