6-chloro-5-cyclohexyl-3-oxo-1,2-dihydroindene-1-carboxylic acid structure
|
Common Name | 6-chloro-5-cyclohexyl-3-oxo-1,2-dihydroindene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 31861-70-8 | Molecular Weight | 292.75700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-chloro-5-cyclohexyl-3-oxo-1,2-dihydroindene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H17ClO3 |
|---|---|
| Molecular Weight | 292.75700 |
| Exact Mass | 292.08700 |
| PSA | 54.37000 |
| LogP | 4.14230 |
| InChIKey | NUWPFWQEGGSHKJ-UHFFFAOYSA-N |
| SMILES | O=C1CC(C(=O)O)c2cc(Cl)c(C3CCCCC3)cc21 |
| HS Code | 2920909090 |
|---|
|
~%
6-chloro-5-cycl... CAS#:31861-70-8 |
| Literature: Noguchi; Kishimoto; Minamida; Obayashi Chemical and Pharmaceutical Bulletin, 1974 , vol. 22, # 3 p. 529 - 536 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 6-Chlor-5-cyclohexyl-3-oxoindan-1-carbonsaeure |
| 6-Chloro-5-cyclohexyl-3-oxoindan-1-carboxylicacid |
| TAI 216 |
| 3-Oxo-5-cyclohexyl-6-chlorindan-1-carbonsaeure |
| 1H-Indene-1-carboxylicacid,6-chloro-5-cyclohexyl-2,3-dihydro-3-oxo |