2,6-DIMETHYL-3,5-DINITROPYRIDIN-4-OL
Modify Date: 2025-08-25 18:47:23
2,6-DIMETHYL-3,5-DINITROPYRIDIN-4-OL structure
|
Common Name | 2,6-DIMETHYL-3,5-DINITROPYRIDIN-4-OL | ||
|---|---|---|---|---|
| CAS Number | 31872-55-6 | Molecular Weight | 213.14800 | |
| Density | 1.552g/cm3 | Boiling Point | 369ºC at 760 mmHg | |
| Molecular Formula | C7H7N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177ºC | |
| Name | 2,6-dimethyl-3,5-dinitro-1H-pyridin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.552g/cm3 |
|---|---|
| Boiling Point | 369ºC at 760 mmHg |
| Molecular Formula | C7H7N3O5 |
| Molecular Weight | 213.14800 |
| Flash Point | 177ºC |
| Exact Mass | 213.03900 |
| PSA | 124.50000 |
| LogP | 1.85450 |
| Index of Refraction | 1.631 |
| InChIKey | GSCRIRIDISHTJY-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c(C)c([N+](=O)[O-])c(=O)c1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
|
~%
2,6-DIMETHYL-3,... CAS#:31872-55-6 |
| Literature: Reich; Fabio; Lee; Kuck; Testa Journal of Medicinal Chemistry, 1989 , vol. 32, # 11 p. 2474 - 2485 |
|
~%
2,6-DIMETHYL-3,... CAS#:31872-55-6 |
| Literature: Fujimoto Pharmaceutical Bulletin, 1956 , vol. 4, p. 77 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-dimethyl-3,5-dinitro-4-pyridinol |
| 2,6-Dimethyl-4-hydroxy-3,5-dinitropyridine |
| 2,6-dimethyl-3,5-dinitro-pyridin-4-ol |