2-methylanthracene-1,4-dione structure
|
Common Name | 2-methylanthracene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 31907-39-8 | Molecular Weight | 222.23900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methylanthracene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H10O2 |
|---|---|
| Molecular Weight | 222.23900 |
| Exact Mass | 222.06800 |
| PSA | 34.14000 |
| LogP | 3.16510 |
| InChIKey | JYJDINHXEIVCTN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)c2cc3ccccc3cc2C1=O |
|
~48%
2-methylanthrac... CAS#:31907-39-8 |
| Literature: Laatssh, Hartmut; Schmidt, Andreas Johann Zeitschrift fuer Naturforschung, B: Chemical Sciences, 1993 , vol. 48, # 9 p. 1291 - 1294 |
|
~39%
2-methylanthrac... CAS#:31907-39-8 |
| Literature: Barranco, Elena; Martin, Nazario; Segura, Jose L.; Seoane, Carlos; De La Cruz, Pilar; Langa, Fernando; Gonzalez, Araceli; Pingarron, Jose M. Tetrahedron, 1993 , vol. 49, # 22 p. 4881 - 4892 |
|
~%
2-methylanthrac... CAS#:31907-39-8 |
| Literature: Sartori, Giovanni; Bigi, Franca; Maggi, Raimondo; Pastorio, Andrea; Porta, Cecilia; Bonfanti, Gianmarco Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1994 , # 13 p. 1879 - 1882 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 2-Methyl-1,4-anthrachinon |
| 2-methyl-1,4-anthracenedione |
| 2-methyl-1,4-anthraquinone |
| 1,4-Anthracenedione,2-methyl |