1,4-Dihydro-6-Methoxy-2,3-Quinoxalinedione structure
|
Common Name | 1,4-Dihydro-6-Methoxy-2,3-Quinoxalinedione | ||
|---|---|---|---|---|
| CAS Number | 31910-18-6 | Molecular Weight | 192.17100 | |
| Density | 1.322g/cm3 | Boiling Point | 491.1ºC at 760mmHg | |
| Molecular Formula | C9H8N2O3 | Melting Point | 350℃ | |
| MSDS | N/A | Flash Point | 250.8ºC | |
| Name | 6-methoxy-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.322g/cm3 |
|---|---|
| Boiling Point | 491.1ºC at 760mmHg |
| Melting Point | 350℃ |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17100 |
| Flash Point | 250.8ºC |
| Exact Mass | 192.05300 |
| PSA | 74.95000 |
| LogP | 0.22500 |
| Index of Refraction | 1.566 |
| InChIKey | CHTYMWBYHAIEOF-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3-DIAMIDOXIMO-5,6-DIMETHYLPYRAZINE |
| 2,3-Dihydroxy-6-methoxyquinoxaline |
| 6-methoxy-quinoxaline-2,3-diol |