AG-13958 structure
|
Common Name | AG-13958 | ||
|---|---|---|---|---|
| CAS Number | 319460-94-1 | Molecular Weight | 467.498 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 648.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C26H22FN7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 345.9±31.5 °C | |
Use of AG-13958AG-13958 (AG-013958), a potent VEGFR tyrosine kinase inhibitor, is used for treatment of choroidal neovascularization associated with age-related macular degeneration (AMD)[1]. |
| Name | N-[2-Fluoro-5-({3-[(E)-2-(2-pyridinyl)vinyl]-1H-indazol-6-yl}amin o)phenyl]-1,3-dimethyl-1H-pyrazole-5-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | AG-13958 (AG-013958), a potent VEGFR tyrosine kinase inhibitor, is used for treatment of choroidal neovascularization associated with age-related macular degeneration (AMD)[1]. |
|---|---|
| Related Catalog | |
| Target |
VEGFR |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 648.4±55.0 °C at 760 mmHg |
| Molecular Formula | C26H22FN7O |
| Molecular Weight | 467.498 |
| Flash Point | 345.9±31.5 °C |
| Exact Mass | 467.186981 |
| PSA | 100.52000 |
| LogP | 3.35 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.691 |
| InChIKey | JXSVVZKPEDIRTN-DHZHZOJOSA-N |
| SMILES | Cc1cc(C(=O)Nc2cc(Nc3ccc4c(C=Cc5ccccn5)n[nH]c4c3)ccc2F)n(C)n1 |
| N-[2-Fluoro-5-({3-[(E)-2-(2-pyridinyl)vinyl]-1H-indazol-6-yl}amino)phenyl]-1,4-dimethyl-1H-pyrazole-5-carboxamide |
| 2,5-dimethyl-2H-pyrazole-3-carboxylic acid {2-fluoro-5-[3-((E)-2-pyridin-2-yl-vinyl)-1H-indazol-6-ylamino]-phenyl}-amide |
| 1H-Pyrazole-5-carboxamide, N-[2-fluoro-5-[[3-[(E)-2-(2-pyridinyl)ethenyl]-1H-indazol-6-yl]amino]phenyl]-1,3-dimethyl- |
| 6-[N-(3-((1,3-dimethyl-1H-pyrazol-5-yl)carboxamido)-4-fluoro-phenyl)amino]-3-(E)-[2-(pyridin-2-yl)ethenyl]-1H-indazole |
| N-[2-Fluoro-5-({3-[(E)-2-(2-pyridinyl)vinyl]-1H-indazol-6-yl}amino)phenyl]-1,3-dimethyl-1H-pyrazole-5-carboxamide |
| 6-[methyl(phenylsulfonyl)amino]-hexanoic acid |
| 1H-Pyrazole-5-carboxamide, N-[2-fluoro-5-[[3-[(E)-2-(2-pyridinyl)ethenyl]-1H-indazol-6-yl]amino]phenyl]-1,4-dimethyl- |
| 6-(benzenesulfonyl-methyl-amino)-hexanoic acid |
| 6-(Methyl(phenylsulphonyl)amino)hexanoic acid |
| 6-(Benzolsulfonyl-methyl-amino)-hexansaeure |