Imidazole,2,2'-azobis[4,5-diphenyl- (7CI,8CI) structure
|
Common Name | Imidazole,2,2'-azobis[4,5-diphenyl- (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 31950-67-1 | Molecular Weight | 466.53600 | |
| Density | 1.25g/cm3 | Boiling Point | 664.4ºC at 760mmHg | |
| Molecular Formula | C30H22N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 355.6ºC | |
| Name | N-[(4,5-diphenylimidazol-2-ylidene)amino]-4,5-diphenyl-1H-imidazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 664.4ºC at 760mmHg |
| Molecular Formula | C30H22N6 |
| Molecular Weight | 466.53600 |
| Flash Point | 355.6ºC |
| Exact Mass | 466.19100 |
| PSA | 82.08000 |
| LogP | 8.21620 |
| Index of Refraction | 1.7 |
| InChIKey | QXLSJYLIVVIWCQ-ULDVOPSXSA-N |
| SMILES | c1ccc(-c2nc(N=Nc3nc(-c4ccccc4)c(-c4ccccc4)[nH]3)[nH]c2-c2ccccc2)cc1 |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,5,4',5'-tetraphenyl-1H,1'H-2,2'-diazenediyl-bis-imidazole |
| Imidazole,2,2'-azobis[4,5-diphenyl-(7CI,8CI) |
| 4,4',5,5'-Tetraphenyl-2,2'-azoimidazol |