2-amino-4-(3-amino-3-carboxy-propyl)sulfonyl-butanoic acid
Modify Date: 2025-09-01 11:32:03
2-amino-4-(3-amino-3-carboxy-propyl)sulfonyl-butanoic acid structure
|
Common Name | 2-amino-4-(3-amino-3-carboxy-propyl)sulfonyl-butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 31982-10-2 | Molecular Weight | 268.28700 | |
| Density | 1.498g/cm3 | Boiling Point | 626.8ºC at 760 mmHg | |
| Molecular Formula | C8H16N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 332.9ºC | |
| Name | L-homolanthionine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.498g/cm3 |
|---|---|
| Boiling Point | 626.8ºC at 760 mmHg |
| Molecular Formula | C8H16N2O6S |
| Molecular Weight | 268.28700 |
| Flash Point | 332.9ºC |
| Exact Mass | 268.07300 |
| PSA | 169.16000 |
| LogP | 0.48660 |
| Index of Refraction | 1.566 |
| InChIKey | MBEPFGPQVBIIES-WDSKDSINSA-N |
| SMILES | NC(CCSCCC(N)C(=O)O)C(=O)O |
| HS Code | 2930909090 |
|---|
|
~%
2-amino-4-(3-am... CAS#:31982-10-2 |
| Literature: Weiss; Stekol Journal of the American Chemical Society, 1951 , vol. 73, p. 2497 |
|
~%
2-amino-4-(3-am... CAS#:31982-10-2 |
| Literature: Kanzaki, Hiroshi; Kobayashi, Michihiko; Nagasawa, Toru; Yamada, Hideaki Agricultural and Biological Chemistry, 1986 , vol. 50, # 2 p. 391 - 398 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| L-Homolanthionine |
| meso-homolanthione |
| 2-amino-4-(3-amino-3-carboxypropyl)sulfonylbutanoic acid |
| homolanthionine |
| meso-Homolanthionin |
| Homolanthionine sulfone |