2-bromo-7-iodo-9,9-dimethyl-9H-fluorene structure
|
Common Name | 2-bromo-7-iodo-9,9-dimethyl-9H-fluorene | ||
|---|---|---|---|---|
| CAS Number | 319906-45-1 | Molecular Weight | 399.064 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 424.2±38.0 °C at 760 mmHg | |
| Molecular Formula | C15H12BrI | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.4±26.8 °C | |
| Name | 2-bromo-7-iodo-9,9-dimethylfluorene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 424.2±38.0 °C at 760 mmHg |
| Molecular Formula | C15H12BrI |
| Molecular Weight | 399.064 |
| Flash Point | 210.4±26.8 °C |
| Exact Mass | 397.916687 |
| LogP | 7.00 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.667 |
| InChIKey | LOXUVZPMEXKUEJ-UHFFFAOYSA-N |
| SMILES | CC1(C)c2cc(Br)ccc2-c2ccc(I)cc21 |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 9H-Fluorene, 2-bromo-7-iodo-9,9-dimethyl- |
| 2-Bromo-7-iodo-9,9-dimethyl-9H-fluorene |
| 7-Bromo-2-Iodo-9,9-Dimethyl-9H-Fluorene |
| 2-Brom-7-iod-9,9-dimethyl-9H-fluoren |