Benzamide,N,N'-1,4-butanediylbis
Benzamide,N,N'-1,4-butanediylbis structure
|
Common Name | Benzamide,N,N'-1,4-butanediylbis | ||
|---|---|---|---|---|
| CAS Number | 31991-78-3 | Molecular Weight | 296.36400 | |
| Density | 1.122g/cm3 | Boiling Point | 596.9ºC at 760mmHg | |
| Molecular Formula | C18H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4-benzamidobutyl)benzamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.122g/cm3 |
|---|---|
| Boiling Point | 596.9ºC at 760mmHg |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.36400 |
| Flash Point | 225.1ºC |
| Exact Mass | 296.15200 |
| PSA | 58.20000 |
| LogP | 3.40840 |
| Index of Refraction | 1.572 |
| InChIKey | QSFWQDFBUPYPIH-UHFFFAOYSA-N |
| SMILES | O=C(NCCCCNC(=O)c1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 7 | |
CAS#:98-88-4
CAS#:110-60-1
CAS#:10364-94-0
CAS#:333-93-7
CAS#:7646-66-4
CAS#:120-12-7
CAS#:100-52-7
CAS#:5692-23-9
CAS#:13435-07-9
CAS#:857488-39-2
CAS#:110-52-1
CAS#:100-47-0
CAS#:6345-94-4
CAS#:110-56-5
CAS#:31719-05-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N,N'-dibenzoyl-1,4-diaminobutane |
| N,N'-Butandiyl-bis-benzamid |
| N,N'-tetramethylenedibenzamide |
| N,N'-dibenzoyl-1,3-diaminopropan-2-ol |
| uvariadiamide |
| N.N'-Dibenzoyl-putrescin |
| N,N'-butanediyl-bis-benzamide |
| N,N'-dibenzoyl-1,4-butylenediamine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-(4-benzamidobutyl)benzamide? |
| A: Molecular weight of N-(4-benzamidobutyl)benzamide is 296.36400. |
| Q: What is the CAS number of N-(4-benzamidobutyl)benzamide? |
| A: CAS number of N-(4-benzamidobutyl)benzamide is 31991-78-3. |
| Q: What are the downstream products of N-(4-benzamidobutyl)benzamide? |
| A: Related downstream products(CAS) of N-(4-benzamidobutyl)benzamide: 110-52-1;100-47-0;6345-94-4;110-56-5;31719-05-8;110-60-1;5692-23-9. |
| Q: What is the SMILES notation of N-(4-benzamidobutyl)benzamide? |
| A: SMILES notation of N-(4-benzamidobutyl)benzamide is O=C(NCCCCNC(=O)c1ccccc1)c1ccccc1. |
| Q: What is the English name of N-(4-benzamidobutyl)benzamide? |
| A: The English name of N-(4-benzamidobutyl)benzamide is N-(4-benzamidobutyl)benzamide. |
| Q: What is the boiling point of N-(4-benzamidobutyl)benzamide? |
| A: Boiling point of N-(4-benzamidobutyl)benzamide is 596.9ºC at 760mmHg. |
| Q: What is the InChIKey of N-(4-benzamidobutyl)benzamide? |
| A: InChIKey of N-(4-benzamidobutyl)benzamide is QSFWQDFBUPYPIH-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-(4-benzamidobutyl)benzamide? |
| A: Molecular formula of N-(4-benzamidobutyl)benzamide is C18H20N2O2. |
| Q: What are the upstream materials of N-(4-benzamidobutyl)benzamide? |
| A: Related upstream materials(CAS) of N-(4-benzamidobutyl)benzamide: 98-88-4;110-60-1;10364-94-0;333-93-7;7646-66-4;120-12-7;100-52-7;5692-23-9;13435-07-9;857488-39-2. |
| Q: What is the LogP of N-(4-benzamidobutyl)benzamide? |
| A: LogP of N-(4-benzamidobutyl)benzamide is 3.40840. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| BioBioPha |
| Dayang Chem (Hangzhou) Co., Ltd. |
| naturewill |