N-(5-benzamidopentyl)benzamide
N-(5-benzamidopentyl)benzamide structure
|
Common Name | N-(5-benzamidopentyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 31991-79-4 | Molecular Weight | 310.39000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(5-benzamidopentyl)benzamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H22N2O2 |
|---|---|
| Molecular Weight | 310.39000 |
| Exact Mass | 310.16800 |
| PSA | 65.18000 |
| LogP | 4.16630 |
| InChIKey | ASAXBZCWQACEQP-UHFFFAOYSA-N |
| SMILES | O=C(NCCCCCNC(=O)c1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 2 | |
CAS#:462-94-2
CAS#:98-88-4
CAS#:93-97-0
CAS#:32513-92-1
CAS#:1476-39-7
CAS#:93-99-2
CAS#:65-85-0
CAS#:100-52-7
CAS#:628-76-2
CAS#:100-47-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N,N'-dibenzoyl-1,5-pentylenediamine |
| N,N'-pentanediyl-bis-benzamide |
| N.N'-Dibenzoyl-pentamethylendiamin |
| N,N'-pentane-1,5-diyldibenzamide |
| Benzamide,N,N'-1,5-pentanediylbis |
| 1.5-Bis-benzamino-pentan |
| N,N'-Pentandiyl-bis-benzamid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of N-(5-benzamidopentyl)benzamide? |
| A: Related downstream products(CAS) of N-(5-benzamidopentyl)benzamide: 628-76-2;100-47-0. |
| Q: What English synonyms does N-(5-benzamidopentyl)benzamide have? |
| A: English synonyms of N-(5-benzamidopentyl)benzamide: N,N'-dibenzoyl-1,5-pentylenediamine, N,N'-pentanediyl-bis-benzamide, N.N'-Dibenzoyl-pentamethylendiamin, N,N'-pentane-1,5-diyldibenzamide, Benzamide,N,N'-1,5-pentanediylbis, 1.5-Bis-benzamino-pentan, N,N'-Pentandiyl-bis-benzamid. |
| Q: What is the LogP of N-(5-benzamidopentyl)benzamide? |
| A: LogP of N-(5-benzamidopentyl)benzamide is 4.16630. |
| Q: What is the molecular weight of N-(5-benzamidopentyl)benzamide? |
| A: Molecular weight of N-(5-benzamidopentyl)benzamide is 310.39000. |
| Q: What is the CAS number of N-(5-benzamidopentyl)benzamide? |
| A: CAS number of N-(5-benzamidopentyl)benzamide is 31991-79-4. |
| Q: What is the polar surface area (PSA) of N-(5-benzamidopentyl)benzamide? |
| A: Polar surface area (PSA) of N-(5-benzamidopentyl)benzamide is 65.18000. |
| Q: What is the Chinese name of 31991-79-4? |
| A: Chinese name of 31991-79-4 is 31991-79-4. |
| Q: What is the English name of N-(5-benzamidopentyl)benzamide? |
| A: The English name of N-(5-benzamidopentyl)benzamide is N-(5-benzamidopentyl)benzamide. |
| Q: What is the InChIKey of N-(5-benzamidopentyl)benzamide? |
| A: InChIKey of N-(5-benzamidopentyl)benzamide is ASAXBZCWQACEQP-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N-(5-benzamidopentyl)benzamide? |
| A: SMILES notation of N-(5-benzamidopentyl)benzamide is O=C(NCCCCCNC(=O)c1ccccc1)c1ccccc1. |