Uracil, 5-(dimethylamino)-6-methyl-1-phenyl- structure
|
Common Name | Uracil, 5-(dimethylamino)-6-methyl-1-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 31992-01-5 | Molecular Weight | 245.27700 | |
| Density | 1.26g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(dimethylamino)-6-methyl-1-phenylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.27700 |
| Exact Mass | 245.11600 |
| PSA | 58.36000 |
| LogP | 1.31250 |
| Index of Refraction | 1.62 |
| InChIKey | XAMZAUGUBOIFKY-UHFFFAOYSA-N |
| SMILES | Cc1c(N(C)C)c(=O)[nH]c(=O)n1-c1ccccc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-dimethylamino-6-methyl-1-phenyl-1H-pyrimidine-2,4-dione |
| 2,4(1H,3H)-Pyrimidinedione,5-dimethylamino-6-methyl-1-phenyl |
| 5-Dimethylamino-6-methyl-1-phenyluracil |
| 5-(dimethylamino)-6-methyl-1-phenylpyrimidine-2,4(1h,3h)-dione |
| Uracil,5-(dimethylamino)-6-methyl-1-phenyl |