5-Chloro-2-(trifluoromethyl)benzoyl chloride structure
|
Common Name | 5-Chloro-2-(trifluoromethyl)benzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 320-84-3 | Molecular Weight | 243.01000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H3Cl2F3O | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | 5-Chloro-2-(trifluoromethyl)benzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H3Cl2F3O |
|---|---|
| Molecular Weight | 243.01000 |
| Exact Mass | 241.95100 |
| PSA | 17.07000 |
| LogP | 3.73780 |
| InChIKey | HSKPEPFDFCWQGY-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1cc(Cl)ccc1C(F)(F)F |
| HS Code | 2916399090 |
|---|
|
~%
5-Chloro-2-(tri... CAS#:320-84-3 |
| Literature: Wacker, Dean A.; Varnes, Jeffrey G.; Malmstrom, Sarah E.; Cao, Xueying; Hung, Chen-Pin; Ung, Thao; Wu, Ginger; Zhang, Ge; Zuvich, Eva; Thomas, Michael A.; Keim, William J.; Cullen, Mary Jane; Rohrbach, Kenneth W.; Qu, Qinling; Narayanan, Rangaraj; Rossi, Karen; Janovitz, Evan; Lehman-McKeeman, Lois; Malley, Mary F.; Devenny, James; Pelleymounter, Mary Ann; Miller, Keith J.; Robl, Jeffrey A. Journal of Medicinal Chemistry, 2007 , vol. 50, # 6 p. 1365 - 1379 |
|
~%
5-Chloro-2-(tri... CAS#:320-84-3 |
| Literature: Gen. Aniline Works Patent: US2180772 , 1936 ; |
|
~%
5-Chloro-2-(tri... CAS#:320-84-3 |
| Literature: Gen. Aniline Works Patent: US2180772 , 1936 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 5-chloro-2-trifluoromethylbenzoic acid chloride |
| PC0189 |
| 5-Chlor-2-trifluormethyl-benzoylchlorid |
| 5-chloro-2-trifluoromethyl-benzoyl chloride |