5-Chloro-2-(trifluoromethyl)benzoic acid
5-Chloro-2-(trifluoromethyl)benzoic acid structure
|
Common Name | 5-Chloro-2-(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 654-98-8 | Molecular Weight | 224.564 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 272.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H4ClF3O2 | Melting Point | 84-87ºC | |
| MSDS | N/A | Flash Point | 118.4±27.3 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Chloro-2-(trifluoromethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 272.2±40.0 °C at 760 mmHg |
| Melting Point | 84-87ºC |
| Molecular Formula | C8H4ClF3O2 |
| Molecular Weight | 224.564 |
| Flash Point | 118.4±27.3 °C |
| Exact Mass | 223.985199 |
| PSA | 37.30000 |
| LogP | 3.94 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | FWLFUSUVWNEKRN-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Cl)ccc1C(F)(F)F |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 4 | |
CAS#:261763-21-7
CAS#:320-84-3
CAS#:1381846-25-8
CAS#:521064-74-4This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-Chloro-α,α,α-trifluoro-o-toluic acid |
| 5-Chloro-2-(trifluoromethyl)benzoic acid |
| 5-Chlor-2-trifluormethyl-benzoesaeure |
| MFCD01631353 |
| 5-chloro-2-trifluoromethyl-benzoic acid |
| QVR CG FXFFF |
| 3-Chloro-6-trifluoro-methyl benzoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 5-Chloro-2-(trifluoromethyl)benzoic acid? |
| A: LogP of 5-Chloro-2-(trifluoromethyl)benzoic acid is 3.94. |
| Q: What are the downstream products of 5-Chloro-2-(trifluoromethyl)benzoic acid? |
| A: Related downstream products(CAS) of 5-Chloro-2-(trifluoromethyl)benzoic acid: 261763-21-7;320-84-3;1381846-25-8;521064-74-4. |
| Q: What is the English name of 5-Chloro-2-(trifluoromethyl)benzoic acid? |
| A: The English name of 5-Chloro-2-(trifluoromethyl)benzoic acid is 5-Chloro-2-(trifluoromethyl)benzoic acid. |
| Q: What is the melting point of 5-Chloro-2-(trifluoromethyl)benzoic acid? |
| A: Melting point of 5-Chloro-2-(trifluoromethyl)benzoic acid is 84-87ºC. |
| Q: What English synonyms does 5-Chloro-2-(trifluoromethyl)benzoic acid have? |
| A: English synonyms of 5-Chloro-2-(trifluoromethyl)benzoic acid: 5-Chloro-α,α,α-trifluoro-o-toluic acid, 5-Chloro-2-(trifluoromethyl)benzoic acid, 5-Chlor-2-trifluormethyl-benzoesaeure, MFCD01631353, 5-chloro-2-trifluoromethyl-benzoic acid, QVR CG FXFFF, 3-Chloro-6-trifluoro-methyl benzoic acid. |
| Q: What is the molecular weight of 5-Chloro-2-(trifluoromethyl)benzoic acid? |
| A: Molecular weight of 5-Chloro-2-(trifluoromethyl)benzoic acid is 224.564. |
| Q: What is the molecular formula of 5-Chloro-2-(trifluoromethyl)benzoic acid? |
| A: Molecular formula of 5-Chloro-2-(trifluoromethyl)benzoic acid is C8H4ClF3O2. |
| Q: What is the InChIKey of 5-Chloro-2-(trifluoromethyl)benzoic acid? |
| A: InChIKey of 5-Chloro-2-(trifluoromethyl)benzoic acid is FWLFUSUVWNEKRN-UHFFFAOYSA-N. |
| Q: What is the boiling point of 5-Chloro-2-(trifluoromethyl)benzoic acid? |
| A: Boiling point of 5-Chloro-2-(trifluoromethyl)benzoic acid is 272.2±40.0 °C at 760 mmHg. |
| Q: What is the CAS number of 5-Chloro-2-(trifluoromethyl)benzoic acid? |
| A: CAS number of 5-Chloro-2-(trifluoromethyl)benzoic acid is 654-98-8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |