(5-Fluoro-2-methyl-1H-inden-3-yl)acetic acid structure
|
Common Name | (5-Fluoro-2-methyl-1H-inden-3-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 32004-66-3 | Molecular Weight | 206.213 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 344.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H11FO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.1±27.9 °C | |
| Name | 2-(5-Fluoro-2-methyl-1H-inden-3-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 344.5±42.0 °C at 760 mmHg |
| Molecular Formula | C12H11FO2 |
| Molecular Weight | 206.213 |
| Flash Point | 162.1±27.9 °C |
| Exact Mass | 206.074310 |
| PSA | 37.30000 |
| LogP | 3.07 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | QDDPPRDVFIJASZ-UHFFFAOYSA-N |
| SMILES | CC1=C(CC(=O)O)c2cc(F)ccc2C1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2916399090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (5-Fluoro-2-methyl-1H-inden-3-yl)acetic acid |
| 2-(6-fluoro-2-methyl-3H-inden-1-yl)acetic acid |