5-Amino-1-cyclohexyl-1H-1,2,3-triazole-4-carboxylic acid
Modify Date: 2026-07-08 02:54:44
5-Amino-1-cyclohexyl-1H-1,2,3-triazole-4-carboxylic acid structure
|
Common Name | 5-Amino-1-cyclohexyl-1H-1,2,3-triazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 32016-39-0 | Molecular Weight | 210.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Amino-1-cyclohexyl-1H-1,2,3-triazole-4-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H14N4O2 |
|---|---|
| Molecular Weight | 210.23 |
| InChIKey | UCTPSAKUFYDNCE-UHFFFAOYSA-N |
| SMILES | Nc1c(C(=O)O)nnn1C1CCCCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5-Amino-1-cyclohexyl-1H-1,2,3-triazole-4-carboxylic acid? |
| A: Molecular weight of 5-Amino-1-cyclohexyl-1H-1,2,3-triazole-4-carboxylic acid is 210.23. |
| Q: What is the CAS number of 5-Amino-1-cyclohexyl-1H-1,2,3-triazole-4-carboxylic acid? |
| A: CAS number of 5-Amino-1-cyclohexyl-1H-1,2,3-triazole-4-carboxylic acid is 32016-39-0. |
| Q: What is the molecular formula of 5-Amino-1-cyclohexyl-1H-1,2,3-triazole-4-carboxylic acid? |
| A: Molecular formula of 5-Amino-1-cyclohexyl-1H-1,2,3-triazole-4-carboxylic acid is C9H14N4O2. |
| Q: What is the InChIKey of 5-Amino-1-cyclohexyl-1H-1,2,3-triazole-4-carboxylic acid? |
| A: InChIKey of 5-Amino-1-cyclohexyl-1H-1,2,3-triazole-4-carboxylic acid is UCTPSAKUFYDNCE-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 5-Amino-1-cyclohexyl-1H-1,2,3-triazole-4-carboxylic acid? |
| A: SMILES notation of 5-Amino-1-cyclohexyl-1H-1,2,3-triazole-4-carboxylic acid is Nc1c(C(=O)O)nnn1C1CCCCC1. |
| Q: What is the English name of 5-Amino-1-cyclohexyl-1H-1,2,3-triazole-4-carboxylic acid? |
| A: The English name of 5-Amino-1-cyclohexyl-1H-1,2,3-triazole-4-carboxylic acid is 5-Amino-1-cyclohexyl-1H-1,2,3-triazole-4-carboxylic acid. |
| Q: What is the Chinese name of 32016-39-0? |
| A: Chinese name of 32016-39-0 is 32016-39-0. |