ethyl 2-methyl-4-phenyl-1,3-thiazole-5-carboxylate structure
|
Common Name | ethyl 2-methyl-4-phenyl-1,3-thiazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 32043-95-1 | Molecular Weight | 247.31300 | |
| Density | 1.188g/cm3 | Boiling Point | 392.2ºC at 760mmHg | |
| Molecular Formula | C13H13NO2S | Melting Point | 44ºC | |
| MSDS | N/A | Flash Point | 191ºC | |
| Name | ethyl 2-methyl-4-phenyl-1,3-thiazole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 392.2ºC at 760mmHg |
| Melting Point | 44ºC |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.31300 |
| Flash Point | 191ºC |
| Exact Mass | 247.06700 |
| PSA | 67.43000 |
| LogP | 3.29520 |
| Index of Refraction | 1.572 |
| InChIKey | UHLMXNFHHFDVPW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1sc(C)nc1-c1ccccc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934100090 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-Methyl-4-phenylthiazol-5-carbonsaeureaethylester |
| ethyl 2-methyl-4-phenyl-5-thiazolecarboxylate |
| 2-methyl-4-phenyl-thiazole-5-carboxylic acid ethyl ester |