bisdechlorogeodin
bisdechlorogeodin structure
|
Common Name | bisdechlorogeodin | ||
|---|---|---|---|---|
| CAS Number | 3209-31-2 | Molecular Weight | 330.28900 | |
| Density | 1.46 g/cm C | Boiling Point | 605.6ºC at 760 mmHg | |
| Molecular Formula | C17H14O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.8ºC | |
Summary: bisdechlorogeodin (Chinese name: 双去氯地道宁, CAS number: 3209-31-2, molecular formula: C17H14O7, molecular weight: 330.29) For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | bisdechlorogeodin |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.46 g/cm C |
|---|---|
| Boiling Point | 605.6ºC at 760 mmHg |
| Molecular Formula | C17H14O7 |
| Molecular Weight | 330.28900 |
| Flash Point | 226.8ºC |
| Exact Mass | 330.07400 |
| PSA | 99.13000 |
| LogP | 1.22690 |
| Index of Refraction | 1.63 |
| InChIKey | JCMPRFCVZKOFIT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=O)C=C(OC)C12Oc1cc(C)cc(O)c1C2=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
bisdechlorogeodin CAS#:3209-31-2 |
| Literature: Huang, Ke-Xue; Yoshida, Yasunori; Mikawa, Kazunobu; Fujii, Isao; Ebizuka, Yutaka; Sankawa, Ushio Biological and Pharmaceutical Bulletin, 1996 , vol. 19, # 1 p. 42 - 46 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Antinematodal activity against Caenorhabditis elegans after 16 to 24 hrs
Source: ChEMBL
Target: Caenorhabditis elegans
External Id: CHEMBL1009567
|
|
Name: Antimicrobial activity against Rhizoctonia solani at <200 ppm
Source: ChEMBL
Target: Rhizoctonia solani
External Id: CHEMBL1009566
|
|
Name: USP8 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 8
External Id: USP8 FAST DUB HTS Primary
|
|
Name: USP17 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 17 like family member 5
External Id: USP17 FAST DUB HTS Primary
|
|
Name: Antimicrobial activity against Gaeumannomyces graminis var. tritici at <200 ppm
Source: ChEMBL
Target: Gaeumannomyces tritici
External Id: CHEMBL1009565
|
|
Name: USP7 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 7
External Id: USP7 FAST DUB HTS Primary
|
|
Name: Antimicrobial activity against Escherichia coli at <200 ppm
Source: ChEMBL
Target: Escherichia coli
External Id: CHEMBL1009564
|
|
Name: USP28 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 28
External Id: USP28 FAST DUB HTS Primary
|
|
Name: USP10 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 10
External Id: USP10 FAST DUB HTS Primary
|
|
Name: UCHL1 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin C-terminal hydrolase L1
External Id: UCHL1 FAST DUB HTS Primary
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| methyl 4-hydroxy-5'-methoxy-6-methyl-3,3'-dioxospiro[1-benzofuran-2,6'-cyclohexa-1,4-diene]-1'-carboxylate |
| 4-Hydroxy-2'-methoxy-6'-methoxycarbonyl-6-methyl-grisdien-(2',5')-dion-(3,4') |
| Antibiotic C3368-A |
| AmbotzLS-1102 |
| didechlorogeodin |
| 4-hydroxy-6'-methoxy-6-methyl-3,4'-dioxo-3H-spiro[benzofuran-2,1'-cyclohexa-2',5'-diene]-2'-carboxylic acid methyl ester |
| Deschlorgeodin |
| Spiro(benzofuran-2(3H),1'-(2,5)cyclohexadiene)-2'-carboxylic acid,4-hydroxy-6'-methoxy-6-methyl-3,4'-dioxo-,methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of bisdechlorogeodin? |
| A: CAS number of bisdechlorogeodin is 3209-31-2. |
| Q: What is the Chinese name of 3209-31-2? |
| A: Chinese name of 3209-31-2 is 3209-31-2. |
| Q: What is the molecular weight of bisdechlorogeodin? |
| A: Molecular weight of bisdechlorogeodin is 330.28900. |
| Q: What is the polar surface area (PSA) of bisdechlorogeodin? |
| A: Polar surface area (PSA) of bisdechlorogeodin is 99.13000. |
| Q: What is the molecular formula of bisdechlorogeodin? |
| A: Molecular formula of bisdechlorogeodin is C17H14O7. |
| Q: What is the English name of bisdechlorogeodin? |
| A: The English name of bisdechlorogeodin is bisdechlorogeodin. |
| Q: What is the LogP of bisdechlorogeodin? |
| A: LogP of bisdechlorogeodin is 1.22690. |
| Q: What are the upstream materials of bisdechlorogeodin? |
| A: Related upstream materials(CAS) of bisdechlorogeodin: 519-57-3. |
| Q: What is the SMILES notation of bisdechlorogeodin? |
| A: SMILES notation of bisdechlorogeodin is COC(=O)C1=CC(=O)C=C(OC)C12Oc1cc(C)cc(O)c1C2=O. |
| Q: What is the boiling point of bisdechlorogeodin? |
| A: Boiling point of bisdechlorogeodin is 605.6ºC at 760 mmHg. |