bisdechlorogeodin structure
|
Common Name | bisdechlorogeodin | ||
|---|---|---|---|---|
| CAS Number | 3209-31-2 | Molecular Weight | 330.28900 | |
| Density | 1.46 g/cm C | Boiling Point | 605.6ºC at 760 mmHg | |
| Molecular Formula | C17H14O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.8ºC | |
| Name | bisdechlorogeodin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46 g/cm C |
|---|---|
| Boiling Point | 605.6ºC at 760 mmHg |
| Molecular Formula | C17H14O7 |
| Molecular Weight | 330.28900 |
| Flash Point | 226.8ºC |
| Exact Mass | 330.07400 |
| PSA | 99.13000 |
| LogP | 1.22690 |
| Index of Refraction | 1.63 |
| InChIKey | JCMPRFCVZKOFIT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=O)C=C(OC)C12Oc1cc(C)cc(O)c1C2=O |
|
~%
bisdechlorogeodin CAS#:3209-31-2 |
| Literature: Huang, Ke-Xue; Yoshida, Yasunori; Mikawa, Kazunobu; Fujii, Isao; Ebizuka, Yutaka; Sankawa, Ushio Biological and Pharmaceutical Bulletin, 1996 , vol. 19, # 1 p. 42 - 46 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| methyl 4-hydroxy-5'-methoxy-6-methyl-3,3'-dioxospiro[1-benzofuran-2,6'-cyclohexa-1,4-diene]-1'-carboxylate |
| 4-Hydroxy-2'-methoxy-6'-methoxycarbonyl-6-methyl-grisdien-(2',5')-dion-(3,4') |
| Antibiotic C3368-A |
| AmbotzLS-1102 |
| didechlorogeodin |
| 4-hydroxy-6'-methoxy-6-methyl-3,4'-dioxo-3H-spiro[benzofuran-2,1'-cyclohexa-2',5'-diene]-2'-carboxylic acid methyl ester |
| Deschlorgeodin |
| Spiro(benzofuran-2(3H),1'-(2,5)cyclohexadiene)-2'-carboxylic acid,4-hydroxy-6'-methoxy-6-methyl-3,4'-dioxo-,methyl ester |