Tris(dimethylamido)aluminum(III) structure
|
Common Name | Tris(dimethylamido)aluminum(III) | ||
|---|---|---|---|---|
| CAS Number | 32093-39-3 | Molecular Weight | 318.41800 | |
| Density | 0.865g/mLat 25°C(lit.) | Boiling Point | 90℃/0.05mm subl. | |
| Molecular Formula | C12H36Al2N6 | Melting Point | 82-84°C(lit.) | |
| MSDS | Chinese USA | Flash Point | 21.1 °C - closed cup | |
| Symbol |
GHS02, GHS05 |
Signal Word | Danger | |
| Name | N-[bis(dimethylamino)alumanyl]-N-methylmethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.865g/mLat 25°C(lit.) |
|---|---|
| Boiling Point | 90℃/0.05mm subl. |
| Melting Point | 82-84°C(lit.) |
| Molecular Formula | C12H36Al2N6 |
| Molecular Weight | 318.41800 |
| Flash Point | 21.1 °C - closed cup |
| Exact Mass | 318.26300 |
| PSA | 19.44000 |
| LogP | 0.07380 |
| Appearance of Characters | Powder,white to yellow |
| InChIKey | JGZUJELGSMSOID-UHFFFAOYSA-N |
| SMILES | CN(C)[Al](N(C)C)N(C)C.CN(C)[Al](N(C)C)N(C)C |
| Symbol |
GHS02, GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H260-H314 |
| Supplemental HS | Reacts violently with water. |
| Precautionary Statements | P223-P231 + P232-P280-P305 + P351 + P338-P370 + P378-P422 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | F;C |
| Risk Phrases | 11-14/15-34 |
| Safety Phrases | 16-26-36/37/39-43 |
| RIDADR | UN 3131 4.3/PG 1 |
| HS Code | 2924199090 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
J. Vac. Sci. Technol. 14 , 306, (1996)
|
| MFCD00269811 |