4-Bromo-2-fluoronitrobenzene structure
|
Common Name | 4-Bromo-2-fluoronitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 321-23-3 | Molecular Weight | 219.996 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 263.2±20.0 °C at 760 mmHg | |
| Molecular Formula | C6H3BrFNO2 | Melting Point | 83-86 | |
| MSDS | Chinese USA | Flash Point | 113.0±21.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-bromo-2-fluoro-1-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 263.2±20.0 °C at 760 mmHg |
| Melting Point | 83-86 |
| Molecular Formula | C6H3BrFNO2 |
| Molecular Weight | 219.996 |
| Flash Point | 113.0±21.8 °C |
| Exact Mass | 218.933105 |
| PSA | 45.82000 |
| LogP | 2.28 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | VQCWSOYHHXXWSP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Br)cc1F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R22;R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2904909090 |
|
~82%
4-Bromo-2-fluor... CAS#:321-23-3 |
| Literature: Liu, Jia; Li, Jue; Ren, Jiangmeng; Zeng, Bu-Bing Tetrahedron Letters, 2014 , vol. 55, # 9 p. 1581 - 1584 |
|
~%
4-Bromo-2-fluor... CAS#:321-23-3 |
| Literature: US2010/280268 A1, ; Page/Page column 22 ; |
|
~%
4-Bromo-2-fluor... CAS#:321-23-3 |
| Literature: Journal of the American Chemical Society, , vol. 78, p. 6034,6037 |
|
~%
4-Bromo-2-fluor... CAS#:321-23-3 |
| Literature: European Journal of Organic Chemistry, , # 13 p. 2956 - 2969 |
|
~%
4-Bromo-2-fluor... CAS#:321-23-3 |
| Literature: Russian Journal of Organic Chemistry, , vol. 42, # 2 p. 214 - 219 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
European J. Org. Chem. , 2956, (2006)
|
| WNR BF DE |
| 4-Brom-2-fluor-1-nitro-benzol |
| 1-Bromo-3-fluoro-4-nitrobenzene |
| MFCD01930221 |
| 5-BROMO-2-NITROFLUOROBENZENE |
| 4-Bromo-2-fluoro-1-nitrobenzene |
| 4-Bromo-2-fluoronitrobenzene |
| 4-bromo-2-fluoro-1-nitro-benzene |
| 2-Fluoro-4-bromonitrobenzene |