Bis(3-chlorophenyl)amine structure
|
Common Name | Bis(3-chlorophenyl)amine | ||
|---|---|---|---|---|
| CAS Number | 32113-77-2 | Molecular Weight | 238.11300 | |
| Density | 1.327g/cm3 | Boiling Point | 341.3ºC at 760 mmHg | |
| Molecular Formula | C12H9Cl2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.2ºC | |
| Name | 3-chloro-N-(3-chlorophenyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.327g/cm3 |
|---|---|
| Boiling Point | 341.3ºC at 760 mmHg |
| Molecular Formula | C12H9Cl2N |
| Molecular Weight | 238.11300 |
| Flash Point | 160.2ºC |
| Exact Mass | 237.01100 |
| PSA | 12.03000 |
| LogP | 4.81000 |
| Index of Refraction | 1.649 |
| InChIKey | YVDNMDPKDNOULT-UHFFFAOYSA-N |
| SMILES | Clc1cccc(Nc2cccc(Cl)c2)c1 |
| HS Code | 2921499090 |
|---|
|
~%
Bis(3-chlorophe... CAS#:32113-77-2 |
| Literature: Journal of Organic Chemistry, , vol. 46, # 17 p. 3522 - 3525 |
|
~%
Bis(3-chlorophe... CAS#:32113-77-2 |
| Literature: Zhurnal Obshchei Khimii, , vol. 24, p. 1038;engl.Ausg.S.1035 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Diphenylamine,3,3'-dichloro |
| 3,3'-dichloro-diphenylamine |