6-bn-camp sodium salt structure
|
Common Name | 6-bn-camp sodium salt | ||
|---|---|---|---|---|
| CAS Number | 32115-08-5 | Molecular Weight | 441.31000 | |
| Density | 1.86g/cm3 | Boiling Point | 719.8ºC at 760 mmHg | |
| Molecular Formula | C17H17N5NaO6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 389.1ºC | |
| Name | 6-bn-camp sodium salt |
|---|---|
| Synonym | More Synonyms |
| Density | 1.86g/cm3 |
|---|---|
| Boiling Point | 719.8ºC at 760 mmHg |
| Molecular Formula | C17H17N5NaO6P |
| Molecular Weight | 441.31000 |
| Flash Point | 389.1ºC |
| Exact Mass | 441.08100 |
| PSA | 153.49000 |
| LogP | 1.72370 |
| Index of Refraction | 1.819 |
| InChIKey | GDDBIAMRTVTOBL-LSCFUAHRSA-N |
| SMILES | O=P1(O)OCC2OC(n3cnc4c(NCc5ccccc5)ncnc43)C(O)C2O1 |
|
~%
6-bn-camp sodiu... CAS#:32115-08-5 |
| Literature: Kataoka; Isono; Yamaji; Kato; Kawada; Imai Chemical and Pharmaceutical Bulletin, 1988 , vol. 36, # 6 p. 2212 - 2219 |
|
~%
6-bn-camp sodiu... CAS#:32115-08-5 |
| Literature: Kataoka; Isono; Yamaji; Kato; Kawada; Imai Chemical and Pharmaceutical Bulletin, 1988 , vol. 36, # 6 p. 2212 - 2219 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Activate a partially purified type II cAMP-dependent protein kinase from bovine brain
Source: ChEMBL
Target: N/A
External Id: CHEMBL824595
|
|
Name: Inhibition of cAMP phosphodiesterase preparation from bovine heart at a substrate con...
Source: ChEMBL
Target: cAMP-specific 3',5'-cyclic phosphodiesterase 4A
External Id: CHEMBL821497
|
|
Name: Inhibition of cAMP phosphodiesterase preparation from rabbit lung at a substrate conc...
Source: ChEMBL
Target: cAMP-specific 3',5'-cyclic phosphodiesterase 4A
External Id: CHEMBL821997
|
|
Name: Susceptibility to be hydrolysed by a partially purified cAMP phosphodiesterase from r...
Source: ChEMBL
Target: cAMP-specific 3',5'-cyclic phosphodiesterase 4A
External Id: CHEMBL821996
|
| N6-benzyladenosine 3',5'-cyclic monophosphate |
| N6-benzyl-O3',O5'-hydroxyphosphoryl-adenosine |
| N6-Benzyl-cAMP |
| N6-BENZYLADENOSINE-3',5'-CYCLIC MONOPHOSPHATE SODIUM SALT |
| ADENOSINE 3',5'-CYCLIC MONOPHOSPHATE,N6-BENZYL-,SODIUM SALT |
| 6-BN-CAMP,NA |
| N6-Benzyladenosine Cyclic 3',5'-phosphat |
| 6-NHCH2C6H5 cAMP |