6-bn-camp sodium salt
6-bn-camp sodium salt structure
|
Common Name | 6-bn-camp sodium salt | ||
|---|---|---|---|---|
| CAS Number | 32115-08-5 | Molecular Weight | 441.31000 | |
| Density | 1.86g/cm3 | Boiling Point | 719.8ºC at 760 mmHg | |
| Molecular Formula | C17H17N5NaO6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 389.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-bn-camp sodium salt |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.86g/cm3 |
|---|---|
| Boiling Point | 719.8ºC at 760 mmHg |
| Molecular Formula | C17H17N5NaO6P |
| Molecular Weight | 441.31000 |
| Flash Point | 389.1ºC |
| Exact Mass | 441.08100 |
| PSA | 153.49000 |
| LogP | 1.72370 |
| Index of Refraction | 1.819 |
| InChIKey | GDDBIAMRTVTOBL-LSCFUAHRSA-N |
| SMILES | O=P1(O)OCC2OC(n3cnc4c(NCc5ccccc5)ncnc43)C(O)C2O1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
6-bn-camp sodiu... CAS#:32115-08-5 |
| Literature: Kataoka; Isono; Yamaji; Kato; Kawada; Imai Chemical and Pharmaceutical Bulletin, 1988 , vol. 36, # 6 p. 2212 - 2219 |
|
~%
6-bn-camp sodiu... CAS#:32115-08-5 |
| Literature: Kataoka; Isono; Yamaji; Kato; Kawada; Imai Chemical and Pharmaceutical Bulletin, 1988 , vol. 36, # 6 p. 2212 - 2219 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Activate a partially purified type II cAMP-dependent protein kinase from bovine brain
Source: ChEMBL
Target: N/A
External Id: CHEMBL824595
|
|
Name: Inhibition of cAMP phosphodiesterase preparation from bovine heart at a substrate con...
Source: ChEMBL
Target: cAMP-specific 3',5'-cyclic phosphodiesterase 4A
External Id: CHEMBL821497
|
|
Name: Inhibition of cAMP phosphodiesterase preparation from rabbit lung at a substrate conc...
Source: ChEMBL
Target: cAMP-specific 3',5'-cyclic phosphodiesterase 4A
External Id: CHEMBL821997
|
|
Name: Susceptibility to be hydrolysed by a partially purified cAMP phosphodiesterase from r...
Source: ChEMBL
Target: cAMP-specific 3',5'-cyclic phosphodiesterase 4A
External Id: CHEMBL821996
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N6-benzyladenosine 3',5'-cyclic monophosphate |
| N6-benzyl-O3',O5'-hydroxyphosphoryl-adenosine |
| N6-Benzyl-cAMP |
| N6-BENZYLADENOSINE-3',5'-CYCLIC MONOPHOSPHATE SODIUM SALT |
| ADENOSINE 3',5'-CYCLIC MONOPHOSPHATE,N6-BENZYL-,SODIUM SALT |
| 6-BN-CAMP,NA |
| N6-Benzyladenosine Cyclic 3',5'-phosphat |
| 6-NHCH2C6H5 cAMP |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 6-bn-camp sodium salt? |
| A: Polar surface area (PSA) of 6-bn-camp sodium salt is 153.49000. |
| Q: What is the CAS number of 6-bn-camp sodium salt? |
| A: CAS number of 6-bn-camp sodium salt is 32115-08-5. |
| Q: What is the LogP of 6-bn-camp sodium salt? |
| A: LogP of 6-bn-camp sodium salt is 1.72370. |
| Q: What is the SMILES notation of 6-bn-camp sodium salt? |
| A: SMILES notation of 6-bn-camp sodium salt is O=P1(O)OCC2OC(n3cnc4c(NCc5ccccc5)ncnc43)C(O)C2O1. |
| Q: What is the molecular formula of 6-bn-camp sodium salt? |
| A: Molecular formula of 6-bn-camp sodium salt is C17H17N5NaO6P. |
| Q: What is the boiling point of 6-bn-camp sodium salt? |
| A: Boiling point of 6-bn-camp sodium salt is 719.8ºC at 760 mmHg. |
| Q: What is the molecular weight of 6-bn-camp sodium salt? |
| A: Molecular weight of 6-bn-camp sodium salt is 441.31000. |
| Q: What are the upstream materials of 6-bn-camp sodium salt? |
| A: Related upstream materials(CAS) of 6-bn-camp sodium salt: 100-52-7;60-92-4. |
| Q: What is the InChIKey of 6-bn-camp sodium salt? |
| A: InChIKey of 6-bn-camp sodium salt is GDDBIAMRTVTOBL-LSCFUAHRSA-N. |
| Q: What English synonyms does 6-bn-camp sodium salt have? |
| A: English synonyms of 6-bn-camp sodium salt: N6-benzyladenosine 3',5'-cyclic monophosphate, N6-benzyl-O3',O5'-hydroxyphosphoryl-adenosine, N6-Benzyl-cAMP, N6-BENZYLADENOSINE-3',5'-CYCLIC MONOPHOSPHATE SODIUM SALT, ADENOSINE 3',5'-CYCLIC MONOPHOSPHATE,N6-BENZYL-,SODIUM SALT, 6-BN-CAMP,NA, N6-Benzyladenosine Cyclic 3',5'-phosphat, 6-NHCH2C6H5 cAMP. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |