Adenosine cyclophosphate structure
|
Common Name | Adenosine cyclophosphate | ||
|---|---|---|---|---|
| CAS Number | 60-92-4 | Molecular Weight | 329.206 | |
| Density | 2.5±0.1 g/cm3 | Boiling Point | 701.5±70.0 °C at 760 mmHg | |
| Molecular Formula | C10H12N5O6P | Melting Point | 260 °C (dec.)(lit.) | |
| MSDS | USA | Flash Point | 378.0±35.7 °C | |
Use of Adenosine cyclophosphatecAMP is a mitogenic messenger and promotes the G1 to S phase transition in the cell cycle. |
| Name | 3',5'-cyclic AMP |
|---|---|
| Synonym | More Synonyms |
| Description | cAMP is a mitogenic messenger and promotes the G1 to S phase transition in the cell cycle. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
| Density | 2.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 701.5±70.0 °C at 760 mmHg |
| Melting Point | 260 °C (dec.)(lit.) |
| Molecular Formula | C10H12N5O6P |
| Molecular Weight | 329.206 |
| Flash Point | 378.0±35.7 °C |
| Exact Mass | 329.052521 |
| PSA | 164.65000 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 2.012 |
| InChIKey | GXYGERHACAPJMO-MCDZGGTQSA-N |
| SMILES | Nc1ncnc2c1ncn2C1OC2COP(=O)(O)OC2C1O.O |
| Water Solubility | 50 mg/mL |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | C:Corrosive |
| Risk Phrases | R34 |
| Safety Phrases | 22-24/25-45-36/37/39-26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | AU7357600 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
|
H4 histamine receptors inhibit steroidogenesis and proliferation in Leydig cells.
J. Endocrinol. 223(3) , 241-53, (2014) The histamine H4 receptor (HRH4), discovered only 13 years ago, is considered a promising drug target for allergy, inflammation, autoimmune disorders and cancer, as reflected by a steadily growing num... |
|
|
Sinensetin enhances adipogenesis and lipolysis by increasing cyclic adenosine monophosphate levels in 3T3-L1 adipocytes.
Biol. Pharm. Bull. 38(4) , 552-8, (2015) Sinensetin is a rare polymethoxylated flavone (PMF) found in certain citrus fruits. In this study, we investigated the effects of sinensetin on lipid metabolism in 3T3-L1 cells. Sinensetin promoted ad... |
|
|
Suppression of InsP3 receptor-mediated Ca2+ signaling alleviates mutant presenilin-linked familial Alzheimer's disease pathogenesis.
J. Neurosci. 34(20) , 6910-23, (2014) Exaggerated intracellular Ca(2+) signaling is a robust proximal phenotype observed in cells expressing familial Alzheimer's disease (FAD)-causing mutant presenilins (PSs). The mechanisms that underlie... |
| Adenosine 3,5'-cyclic monophosphoric acid |
| Adenosine 3',5'-cyclic monophosphate |
| adenosine cyclic-monophosphate |
| cyclic Adenosine 3',5'-monophosphate |
| (4aR,6R,7R,7aS)-6-(6-Amino-9H-purin-9-yl)tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinine-2,7-diol 2-oxide |
| Cyclic AMP |
| 3'5'-cyclic ester of AMP |
| adenosine-cyclic-phosphate |
| cyclic 3',5'-AMP |
| cAMP |
| Adenosine 3‘,5‘-cyclic monophosphate |
| Adenosine 3′,5′-cyclic monophosphate |
| adenosine cyclic 3',5'-phosphate |
| cyclic Adenosine 3',5'-phosphate |
| Cyclic 3',5'-adenylate |
| EINECS 200-492-9 |
| 4H-Furo[3,2-d]-1,3,2-dioxaphosphorin-7-ol, 6-(6-amino-9H-purin-9-yl)tetrahydro-2-hydroxy-, 2-oxide, (4aR,6R,7R,7aS)- |
| 3',5'-Cyclic AMP |
| Adenosine 3',5'-cyclic phosphate |
| 3′,5′-Cyclic AMP |
| Adenosine-3',5'-cyclicmonophosphate |
| MFCD00005845 |
| Adenosine cyclic monophosphate |
| Cyclic adenosine monophosphate |