N-[2-(Diphenylphosphino)benzylidene]cyclohexylamine structure
|
Common Name | N-[2-(Diphenylphosphino)benzylidene]cyclohexylamine | ||
|---|---|---|---|---|
| CAS Number | 321155-13-9 | Molecular Weight | 371.45400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H26NP | Melting Point | 116-120 °C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | (E)-N-Cyclohexyl-1-[2-(diphenylphosphino)phenyl]methanimine |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 116-120 °C |
|---|---|
| Molecular Formula | C25H26NP |
| Molecular Weight | 371.45400 |
| Exact Mass | 371.18000 |
| PSA | 25.95000 |
| LogP | 5.19640 |
| InChIKey | CWYDMJZWNROFGL-UHFFFAOYSA-N |
| SMILES | C(=NC1CCCCC1)c1ccccc1P(c1ccccc1)c1ccccc1 |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2931900090 |
|
~92%
N-[2-(Diphenylp... CAS#:321155-13-9 |
| Literature: Makhubela, Banothile C. E.; Jardine, Anwar; Smith, Gregory S. Green Chemistry, 2012 , vol. 14, # 2 p. 338 - 347 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2-(diphenylphosphanyl)-N-cyclohexyliminobenzaldehyde |
| 2-Pyridineethanamine,N-[[2-(diphenylphosphino)phenyl]methylene] |
| N-[2-(diphenylphosphanyl)benzylidene]-2-(2-pyridyl)ethanamine |
| N-(2-(diphenylphosphino)benzylidene)cyclohexylamine |
| N-[2-(diphenylphosphanyl)benzylidene][2-(2-pyridyl)ethyl]amine |
| Ph2PC6H4C(H)=NCy |
| N-(2-diphenylphosphinobenzylidene)-2-(2-pyridyl)ethylamine |
| Ph2(o-C6H4)CH=N(CH2)2(o-C5H4N) |
| cyclohexyl (2-diphenylphosphanylbenzylidene)amine |