3-(Trifluoromethoxy)benzhydrazide
Modify Date: 2025-10-02 22:57:39
3-(Trifluoromethoxy)benzhydrazide structure
|
Common Name | 3-(Trifluoromethoxy)benzhydrazide | ||
|---|---|---|---|---|
| CAS Number | 321195-88-4 | Molecular Weight | 220.14900 | |
| Density | 1.399g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H7F3N2O2 | Melting Point | 94-96ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(Trifluoromethoxy)benzhydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.399g/cm3 |
|---|---|
| Melting Point | 94-96ºC |
| Molecular Formula | C8H7F3N2O2 |
| Molecular Weight | 220.14900 |
| Exact Mass | 220.04600 |
| PSA | 64.35000 |
| LogP | 2.27990 |
| Index of Refraction | 1.495 |
| InChIKey | MNEXCWJCDZXJLF-UHFFFAOYSA-N |
| SMILES | NNC(=O)c1cccc(OC(F)(F)F)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2928000090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:677713-01-8
CAS#:1014-81-9| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3-(trifluoromethoxy)benzohydrazide |