4-[(4-fluorobenzyl)oxy]-3-methoxybenzenecarbaldehyde structure
|
Common Name | 4-[(4-fluorobenzyl)oxy]-3-methoxybenzenecarbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 321432-05-7 | Molecular Weight | 260.26000 | |
| Density | 1.216g/cm3 | Boiling Point | 397.4ºC at 760 mmHg | |
| Molecular Formula | C15H13FO3 | Melting Point | 80-82ºC | |
| MSDS | N/A | Flash Point | 187.4ºC | |
| Name | 4-[(4-fluorophenyl)methoxy]-3-methoxybenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 397.4ºC at 760 mmHg |
| Melting Point | 80-82ºC |
| Molecular Formula | C15H13FO3 |
| Molecular Weight | 260.26000 |
| Flash Point | 187.4ºC |
| Exact Mass | 260.08500 |
| PSA | 35.53000 |
| LogP | 3.22580 |
| Index of Refraction | 1.576 |
| InChIKey | PGCCPVWYLPJNBO-UHFFFAOYSA-N |
| SMILES | COc1cc(C=O)ccc1OCc1ccc(F)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2913000090 |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| MFCD00202628 |