[1,1-Biphenyl]-3-carboxylic acid, 4-hydroxy structure
|
Common Name | [1,1-Biphenyl]-3-carboxylic acid, 4-hydroxy | ||
|---|---|---|---|---|
| CAS Number | 323-87-5 | Molecular Weight | 214.21700 | |
| Density | 1.292g/cm3 | Boiling Point | 406ºC at 760 mmHg | |
| Molecular Formula | C13H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.5ºC | |
| Name | 2-hydroxy-5-phenylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 406ºC at 760 mmHg |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.21700 |
| Flash Point | 213.5ºC |
| Exact Mass | 214.06300 |
| PSA | 57.53000 |
| LogP | 2.75740 |
| Index of Refraction | 1.639 |
| InChIKey | LGERKUYJCZOBTB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2ccccc2)ccc1O |
| Precursor 10 | |
|---|---|
| DownStream 4 | |
|
Name: Thermal Shift Assay. Domain: start/stop: N44-E168
Source: ChEMBL
Target: Bromodomain-containing protein 4
External Id: CHEMBL5060944
|
|
Name: Thermal Shift Assay. Domain start/stop: M626-G740
Source: ChEMBL
Target: Peregrin
External Id: CHEMBL4650107
|
|
Name: Thermal Shift Assay. Domain: start/stop: M1-L298
Source: ChEMBL
Target: Cyclin-dependent kinase 2
External Id: CHEMBL5062802
|
|
Name: Inhibition of human recombinant MCL-1 (174 to 236) expressed in Escherichia coli BL21...
Source: ChEMBL
Target: Induced myeloid leukemia cell differentiation protein Mcl-1
External Id: CHEMBL3131368
|
|
Name: Inhibition of PTP1B
Source: ChEMBL
Target: Tyrosine-protein phosphatase non-receptor type 1
External Id: CHEMBL905766
|
|
Name: Inhibition of Escherichia coli M15 DXR at 100 uM
Source: ChEMBL
Target: N/A
External Id: CHEMBL1042257
|
|
Name: Antiinflammatory activity against carrageenan-induced foot edema in rat administered ...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL3252206
|
|
Name: Transthyretin (TTR) amyloidogenesis inhibition activity by employing an acid-mediated...
Source: ChEMBL
Target: Transthyretin
External Id: CHEMBL702837
|
|
Name: Thermal Shift Assay. Domain: start/stop: E122-S403
Source: ChEMBL
Target: Aurora kinase A
External Id: CHEMBL5067447
|
|
Name: Transthyretin (TTR) amyloidogenesis inhibition activity by employing an acid-mediated...
Source: ChEMBL
Target: Transthyretin
External Id: CHEMBL702836
|
| [1,4-hydroxy |
| 5-phenylsalicylic acid |
| 6-Hydroxy-3-phenyl-benzoesaeure |
| 4-Hydroxy-biphenyl-3-carbonsaeure |
| 4-hydroxybiphenyl-3-carboxylic acid |
| Salicylic acid,5-phenyl |
| 4-hydroxy[1,1'-biphenyl]-3-carboxylic acid |