5-Bromo-4-hydroxy-3-biphenylcarboxylic acid structure
|
Common Name | 5-Bromo-4-hydroxy-3-biphenylcarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 4906-68-7 | Molecular Weight | 293.113 | |
| Density | 1.6±0.0 g/cm3 | Boiling Point | 439.2±0.0 °C at 760 mmHg | |
| Molecular Formula | C13H9BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.4±0.0 °C | |
Use of 5-Bromo-4-hydroxy-3-biphenylcarboxylic acidAKR1C1-IN-1 is a potent and selective inhibitor of human 20α-hydroxysteroid dehydrogenase (AKR1C1), with a Ki value of 4 nM for AKR1C1[1]. |
| Name | 3-bromo-2-hydroxy-5-phenylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | AKR1C1-IN-1 is a potent and selective inhibitor of human 20α-hydroxysteroid dehydrogenase (AKR1C1), with a Ki value of 4 nM for AKR1C1[1]. |
|---|---|
| Related Catalog | |
| Target |
Ki: 4 nM (AKR1C1), 87 nM (AKR1C2), 4.2 μM (AKR1C3), 18.2 μM (AKR1C4)[1] |
| In Vitro | AKR1C1-IN-1 potently inhibits the metabolism of progesterone in AKR1C1-overexpressed BAECs, and with an IC50 of 460 nM[1]. |
| References |
| Density | 1.6±0.0 g/cm3 |
|---|---|
| Boiling Point | 439.2±0.0 °C at 760 mmHg |
| Molecular Formula | C13H9BrO3 |
| Molecular Weight | 293.113 |
| Flash Point | 219.4±0.0 °C |
| Exact Mass | 291.974000 |
| PSA | 57.53000 |
| LogP | 4.43 |
| Vapour Pressure | 0.0±0.0 mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | XVZSXNULHSIRCQ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2ccccc2)cc(Br)c1O |
|
~%
5-Bromo-4-hydro... CAS#:4906-68-7 |
| Literature: Dow Chem. Co. Patent: US2779785 , 1952 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-Brom-4-hydroxy-biphenyl-3-carbonsaeure |
| 5-bromo-4-hydroxy-biphenyl-3-carboxylic acid |
| [1,1'-Biphenyl]-3-carboxylic acid, 3'-bromo-4-hydroxy- |
| 3-bromo-5-phenylsalicylic acid |
| 3-Bromo-5-phenylsalicylc acid |
| 5-Bromo-4-hydroxy-3-biphenylcarboxylic acid |
| 3'-Bromo-4-hydroxy-3-biphenylcarboxylic acid |
| [1,1'-biphenyl]-3-carboxylic acid,5-bromo-4-hydroxy |
| [1,1'-Biphenyl]-3-carboxylic acid, 5-bromo-4-hydroxy- |