Decyl-TPP structure
|
Common Name | Decyl-TPP | ||
|---|---|---|---|---|
| CAS Number | 32339-43-8 | Molecular Weight | 483.46300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H36BrP | Melting Point | 90°C | |
| MSDS | N/A | Flash Point | N/A | |
Use of Decyl-TPPDecyl-TPP, also known as (1-Decyl)triphenylphosphonium bromide, may be used as intermediate for chemical synthesis, Decyl-TPP can be also used as an inactive control or as a reference to mitoquinone (MitoQ). |
| Name | decyl(triphenyl)phosphanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 90°C |
|---|---|
| Molecular Formula | C28H36BrP |
| Molecular Weight | 483.46300 |
| Exact Mass | 482.17400 |
| PSA | 13.59000 |
| LogP | 4.12520 |
| InChIKey | GVPLMQGXUUHCSB-UHFFFAOYSA-M |
| SMILES | CCCCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| C10H21PPh3Br |
| decanyltriphenylphosphonium bromide |
| decyltriphenylphosphanium bromide |
| EINECS 250-996-8 |
| Decyltriphenylphosphonium bromide |
| MFCD00051854 |