1-ethyl-2-methyl-5,6-dichlorobenzimidazole
1-ethyl-2-methyl-5,6-dichlorobenzimidazole structure
|
Common Name | 1-ethyl-2-methyl-5,6-dichlorobenzimidazole | ||
|---|---|---|---|---|
| CAS Number | 3237-62-5 | Molecular Weight | 229.106 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 370.1±22.0 °C at 760 mmHg | |
| Molecular Formula | C10H10Cl2N2 | Melting Point | 110°C | |
| MSDS | N/A | Flash Point | 177.6±22.3 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,6-Dichloro-1-ethyl-2-methylbenzimidazole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 370.1±22.0 °C at 760 mmHg |
| Melting Point | 110°C |
| Molecular Formula | C10H10Cl2N2 |
| Molecular Weight | 229.106 |
| Flash Point | 177.6±22.3 °C |
| Exact Mass | 228.022110 |
| PSA | 17.82000 |
| LogP | 3.59 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.620 |
| InChIKey | IVVLMQPTQOLYDX-UHFFFAOYSA-N |
| SMILES | CCn1c(C)nc2cc(Cl)c(Cl)cc21 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39-S/37/39-S36-S27 |
| HS Code | 2933990090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-ethyl-2-methy... CAS#:3237-62-5 |
| Literature: US2739149 , ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:3520-43-2This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-ETHYL-2-METHYL-5,6-DICHLORO BENZIMIDAZOLE |
| 5,6-Dichloro-1-ethyl-2-methyl-1H-benzo[d]imidazole |
| 1-ethyl-5,6-dichloro-2-methyl-1H-benzimidazole |
| MFCD00022843 |
| 5,6-Dichloro-1-ethyl-2-methyl-1H-benzoimidazole |
| EINECS 221-797-3 |
| 1-Ethyl-2-Methyl-5,6-Dichloro |
| dichloroethylmethylbenzimidazole |
| 1-ethyl-2-methyl-5,6-dichlorobenzimidazole |
| 5,6-Dichloro-1-ethyl-2-methylbenzimidazole |
| 1-Aethyl-5,6-dichlor-2-methyl-1H-benzimidazol |
| 5,6-dichloro-1-ethyl-2-methyl-1h-benzimidazol |
| 5,6-Dichloro-1-ethyl-2-methyl-1H-benzimidazole |
| N-ETHYL-2-METHYL-5,6-DICHLOROBENZIMIDAZOLE |
| 5,6-dichloro-1-ethyl-2-methyl benzimidazole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 5,6-Dichloro-1-ethyl-2-methylbenzimidazole? |
| A: Related downstream products(CAS) of 5,6-Dichloro-1-ethyl-2-methylbenzimidazole: 3520-43-2. |
| Q: What is the English name of 5,6-Dichloro-1-ethyl-2-methylbenzimidazole? |
| A: The English name of 5,6-Dichloro-1-ethyl-2-methylbenzimidazole is 5,6-Dichloro-1-ethyl-2-methylbenzimidazole. |
| Q: What is the SMILES notation of 5,6-Dichloro-1-ethyl-2-methylbenzimidazole? |
| A: SMILES notation of 5,6-Dichloro-1-ethyl-2-methylbenzimidazole is CCn1c(C)nc2cc(Cl)c(Cl)cc21. |
| Q: What is the LogP of 5,6-Dichloro-1-ethyl-2-methylbenzimidazole? |
| A: LogP of 5,6-Dichloro-1-ethyl-2-methylbenzimidazole is 3.59. |
| Q: What is the CAS number of 5,6-Dichloro-1-ethyl-2-methylbenzimidazole? |
| A: CAS number of 5,6-Dichloro-1-ethyl-2-methylbenzimidazole is 3237-62-5. |
| Q: What are the upstream materials of 5,6-Dichloro-1-ethyl-2-methylbenzimidazole? |
| A: Related upstream materials(CAS) of 5,6-Dichloro-1-ethyl-2-methylbenzimidazole: 63134-16-7;108-24-7. |
| Q: What is the InChIKey of 5,6-Dichloro-1-ethyl-2-methylbenzimidazole? |
| A: InChIKey of 5,6-Dichloro-1-ethyl-2-methylbenzimidazole is IVVLMQPTQOLYDX-UHFFFAOYSA-N. |
| Q: What is the boiling point of 5,6-Dichloro-1-ethyl-2-methylbenzimidazole? |
| A: Boiling point of 5,6-Dichloro-1-ethyl-2-methylbenzimidazole is 370.1±22.0 °C at 760 mmHg. |
| Q: What is the molecular formula of 5,6-Dichloro-1-ethyl-2-methylbenzimidazole? |
| A: Molecular formula of 5,6-Dichloro-1-ethyl-2-methylbenzimidazole is C10H10Cl2N2. |
| Q: What is the molecular weight of 5,6-Dichloro-1-ethyl-2-methylbenzimidazole? |
| A: Molecular weight of 5,6-Dichloro-1-ethyl-2-methylbenzimidazole is 229.106. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |