2-[(4-nitrophenyl)methylideneamino]isoindole-1,3-dione structure
|
Common Name | 2-[(4-nitrophenyl)methylideneamino]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 32387-08-9 | Molecular Weight | 295.25000 | |
| Density | 1.44g/cm3 | Boiling Point | 508ºC at 760 mmHg | |
| Molecular Formula | C15H9N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261ºC | |
| Name | 2-[(E)-(4-nitrophenyl)methylideneamino]isoindole-1,3-dione |
|---|
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 508ºC at 760 mmHg |
| Molecular Formula | C15H9N3O4 |
| Molecular Weight | 295.25000 |
| Flash Point | 261ºC |
| Exact Mass | 295.05900 |
| PSA | 95.56000 |
| LogP | 2.68600 |
| Index of Refraction | 1.694 |
| InChIKey | WULBEMGMONTWBY-CXUHLZMHSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1N=Cc1ccc([N+](=O)[O-])cc1 |
|
~99%
2-[(4-nitrophen... CAS#:32387-08-9 |
| Literature: Hearn, Michael J.; Lucero, Elena R. Journal of Heterocyclic Chemistry, 1982 , vol. 19, p. 1537 - 1539 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |