(E)-6-(2-hydroxyphenyl)-4-oxo-hex-5-enoic acid
Modify Date: 2025-09-12 17:55:17
(E)-6-(2-hydroxyphenyl)-4-oxo-hex-5-enoic acid structure
|
Common Name | (E)-6-(2-hydroxyphenyl)-4-oxo-hex-5-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 3243-93-4 | Molecular Weight | 220.22100 | |
| Density | 1.294g/cm3 | Boiling Point | 461.3ºC at 760 mmHg | |
| Molecular Formula | C12H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.9ºC | |
| Name | (E)-6-(2-hydroxyphenyl)-4-oxohex-5-enoic acid |
|---|
| Density | 1.294g/cm3 |
|---|---|
| Boiling Point | 461.3ºC at 760 mmHg |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22100 |
| Flash Point | 246.9ºC |
| Exact Mass | 220.07400 |
| PSA | 74.60000 |
| LogP | 1.83930 |
| Index of Refraction | 1.616 |
| InChIKey | KNQJRDJKWMXBKG-AATRIKPKSA-N |
| SMILES | O=C(O)CCC(=O)C=Cc1ccccc1O |
| HS Code | 2918990090 |
|---|
|
~%
(E)-6-(2-hydrox... CAS#:3243-93-4 |
| Literature: Sen; Roy Journal of the Indian Chemical Society, 1930 , vol. 7, p. 401,415 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |