INDOLE-3-ACETYL-DL-ASPARTIC ACID structure
|
Common Name | INDOLE-3-ACETYL-DL-ASPARTIC ACID | ||
|---|---|---|---|---|
| CAS Number | 32449-99-3 | Molecular Weight | 290.27100 | |
| Density | 1.478g/cm3 | Boiling Point | 641.7ºC at 760mmHg | |
| Molecular Formula | C14H14N2O5 | Melting Point | 198ºC (dec.)(lit.) | |
| MSDS | USA | Flash Point | 341.9ºC | |
| Name | 2-[[2-(1H-indol-3-yl)acetyl]amino]butanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.478g/cm3 |
|---|---|
| Boiling Point | 641.7ºC at 760mmHg |
| Melting Point | 198ºC (dec.)(lit.) |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.27100 |
| Flash Point | 341.9ºC |
| Exact Mass | 290.09000 |
| PSA | 119.49000 |
| LogP | 1.14540 |
| InChIKey | VAFNMNRKDDAKRM-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(NC(=O)Cc1c[nH]c2ccccc12)C(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933990090 |
|
~%
INDOLE-3-ACETYL... CAS#:32449-99-3 |
| Literature: Canadian Journal of Chemistry, , vol. 34, p. 1356 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
The Role of Amino Acid Permeases and Tryptophan Biosynthesis in Cryptococcus neoformans Survival.
PLoS ONE 10 , e0132369, (2015) Metabolic diversity is an important factor during microbial adaptation to different environments. Among metabolic processes, amino acid biosynthesis has been demonstrated to be relevant for survival f... |
|
|
Spectroscopic, kinetic, and mechanistic study of a new mode of coordination of indole derivatives to platinum(II) and palladium(II) ions in complexes.
Inorg. Chem. 39 , 5004, (2000) Binding of tryptophan residue to intrinsic metal ions in proteins is unknown, and very little is known about the coordinating abilities of indole. Indole-3-acetamide displaces the solvent ligands from... |
| N-(3-Indoleacetyl)-DL-aspartic acid |
| Aspartic acid,N-(3-indolylacetyl) |
| indole-3-acetyl-N-aspartic acid |
| Indole-3-acetyl-L-aspatic acid |
| N-indol-3-ylacetyl-DL-aspartic acid |
| MFCD00050396 |
| Indol-3-acetylaspartic acid |
| Indole-3-acetyl-D,L-aspartic acid |
| N-Indol-3-ylacetyl-DL-asparaginsaeure |
| N-(3-Indolylacetyl)-DL-aspartic acid |