1-(4-methoxyphenyl)-N-(4-methylphenyl)methanimine structure
|
Common Name | 1-(4-methoxyphenyl)-N-(4-methylphenyl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 3246-78-4 | Molecular Weight | 225.28600 | |
| Density | 0.99g/cm3 | Boiling Point | 365.8ºC at 760 mmHg | |
| Molecular Formula | C15H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.1ºC | |
| Name | 1-(4-methoxyphenyl)-N-(4-methylphenyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 365.8ºC at 760 mmHg |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.28600 |
| Flash Point | 142.1ºC |
| Exact Mass | 225.11500 |
| PSA | 21.59000 |
| LogP | 3.75420 |
| Index of Refraction | 1.536 |
| InChIKey | BSINSMVDCTUMHQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=Nc2ccc(C)cc2)cc1 |
| HS Code | 2922299090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 5 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-methoxybenzylidene-4-methylaniline |