Diethyl 4-methoxybenzalmalonate structure
|
Common Name | Diethyl 4-methoxybenzalmalonate | ||
|---|---|---|---|---|
| CAS Number | 6768-23-6 | Molecular Weight | 278.30000 | |
| Density | 1.141g/cm3 | Boiling Point | 156-158ºC 0,1mm | |
| Molecular Formula | C15H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.5ºC | |
| Name | diethyl 2-[(4-methoxyphenyl)methylidene]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.141g/cm3 |
|---|---|
| Boiling Point | 156-158ºC 0,1mm |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30000 |
| Flash Point | 158.5ºC |
| Exact Mass | 278.11500 |
| PSA | 61.83000 |
| LogP | 2.20480 |
| Index of Refraction | 1.53 |
| InChIKey | KUBLMWHFTKNBHL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=Cc1ccc(OC)cc1)C(=O)OCC |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| para-Methoxybenzylidenemalonic acid,diethyl ester |
| Diethyl 4-methoxybenzalmalonate |