Ergosta-7,22-dien-3-one structure
|
Common Name | Ergosta-7,22-dien-3-one | ||
|---|---|---|---|---|
| CAS Number | 32507-77-0 | Molecular Weight | 396.65 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 485.2±44.0 °C at 760 mmHg | |
| Molecular Formula | C28H44O | Melting Point | 183-184℃ | |
| MSDS | N/A | Flash Point | 203.3±23.4 °C | |
Use of Ergosta-7,22-dien-3-oneErgosta-7,22-dien-3-on is a lanosterane isolated from the fruiting bodies of Ganoderma lucidum. ent-16-Kaurene-3b,15b,18-triol inhibits platelet aggregation[1][2]. |
| Name | 17-[(Z)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| Synonym | More Synonyms |
| Description | Ergosta-7,22-dien-3-on is a lanosterane isolated from the fruiting bodies of Ganoderma lucidum. ent-16-Kaurene-3b,15b,18-triol inhibits platelet aggregation[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 485.2±44.0 °C at 760 mmHg |
| Melting Point | 183-184℃ |
| Molecular Formula | C28H44O |
| Molecular Weight | 396.65 |
| Flash Point | 203.3±23.4 °C |
| Exact Mass | 396.339203 |
| PSA | 17.07000 |
| LogP | 9.17 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | AHWOEMBXZXGDBQ-AQGSFBQWSA-N |
| SMILES | CC(C)C(C)C=CC(C)C1CCC2C3=CCC4CC(=O)CCC4(C)C3CCC21C |
| Hazard Codes | Xi |
|---|
|
Name: Inhibition of P-gp in human COLO 320 cells assessed as potentiation of doxorubicin-in...
Source: ChEMBL
Target: ATP-dependent translocase ABCB1
External Id: CHEMBL5122132
|
| (22E)-Ergosta-7,22-dien-3-one |
| Ergosta-7,22-dien-3-one |
| ergost-7,22-diene-3-ol |