WAY-313356 structure
|
Common Name | WAY-313356 | ||
|---|---|---|---|---|
| CAS Number | 325694-03-9 | Molecular Weight | 372.44 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 624.8±65.0 °C at 760 mmHg | |
| Molecular Formula | C21H16N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 331.7±34.3 °C | |
Use of WAY-313356WAY-313356 is an active molecule. |
| Name | WAY-313356 |
|---|---|
| Synonym | More Synonyms |
| Description | WAY-313356 is an active molecule. |
|---|---|
| Related Catalog |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 624.8±65.0 °C at 760 mmHg |
| Molecular Formula | C21H16N4OS |
| Molecular Weight | 372.44 |
| Flash Point | 331.7±34.3 °C |
| Exact Mass | 372.104492 |
| LogP | 5.27 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.681 |
| InChIKey | GAXBCVHTYQLWPJ-UHFFFAOYSA-N |
| SMILES | O=C(CSc1nnc(-c2ccncc2)n1-c1ccccc1)c1ccccc1 |
| Ethanone, 1-phenyl-2-[[4-phenyl-5-(4-pyridinyl)-4H-1,2,4-triazol-3-yl]thio]- |
| 1-Phenyl-2-(4-phenyl-5-pyridin-4-yl-4H-[1,2,4]triazol-3-ylsulfanyl)-ethanone |
| 1-Phenyl-2-{[4-phenyl-5-(4-pyridinyl)-4H-1,2,4-triazol-3-yl]sulfanyl}ethanone |