1-Aziridinecarboxamide,N,N'-(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis- (9CI) structure
|
Common Name | 1-Aziridinecarboxamide,N,N'-(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 3259-65-2 | Molecular Weight | 350.41400 | |
| Density | 1.378g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H22N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-[4-(aziridine-1-carbonylamino)-3-methyl-phenyl]-2-methyl-phenyl]a ziridine-1-carboxamide |
|---|
| Density | 1.378g/cm3 |
|---|---|
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.41400 |
| Exact Mass | 350.17400 |
| PSA | 64.22000 |
| LogP | 3.68720 |
| Index of Refraction | 1.726 |
| InChIKey | FMDPSTITBZDRNU-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2ccc(NC(=O)N3CC3)c(C)c2)ccc1NC(=O)N1CC1 |
| HS Code | 2933990090 |
|---|
|
~%
1-Aziridinecarb... CAS#:3259-65-2 |
| Literature: Iwakura; Naraba Kobunshi Kagaku, 1951 , vol. 8, p. 400,406 Chem.Abstr., 1954 , p. 1983 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |