4,4'-Diisocyanato-3,3'-dimethylbiphenyl structure
|
Common Name | 4,4'-Diisocyanato-3,3'-dimethylbiphenyl | ||
|---|---|---|---|---|
| CAS Number | 91-97-4 | Molecular Weight | 264.279 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 384.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C16H12N2O2 | Melting Point | 70-72°C | |
| MSDS | N/A | Flash Point | 158.8±33.2 °C | |
| Name | 4,4'-Diisocyanato-3,3'-dimethyl-1,1'-biphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 384.8±42.0 °C at 760 mmHg |
| Melting Point | 70-72°C |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.279 |
| Flash Point | 158.8±33.2 °C |
| Exact Mass | 264.089874 |
| PSA | 58.86000 |
| LogP | 5.03 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | ICLCCFKUSALICQ-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2ccc(N=C=O)c(C)c2)ccc1N=C=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xn |
|---|---|
| RTECS | DV3960000 |
| HS Code | 2929109000 |
|
~91%
4,4'-Diisocyana... CAS#:91-97-4 |
| Literature: Butler; Alper Chemical Communications, 1998 , # 23 p. 2575 - 2576 |
|
~%
4,4'-Diisocyana... CAS#:91-97-4 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 562, p. 75,1114 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2929109000 |
|---|---|
| Summary | 2929109000. other isocyanates. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 4,4'-Diisocyanato-3,3'-dimethylbiphenyl |
| MFCD00019908 |
| EINECS 202-112-7 |
| 1-isocyanato-4-(4-isocyanato-3-methylphenyl)-2-methylbenzene |