Di-p-toluoyl-D-tartaric acid structure
|
Common Name | Di-p-toluoyl-D-tartaric acid | ||
|---|---|---|---|---|
| CAS Number | 32634-68-7 | Molecular Weight | 386.35 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 626.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C20H18O8 | Melting Point | 169-171 °C(lit.) | |
| MSDS | USA | Flash Point | 223.2±25.0 °C | |
Use of Di-p-toluoyl-D-tartaric acid(S,S)-O,O'-Di-p-toluoyltartaric acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | 2,3-Di-O-para-toluoyl-D-tartaric acid |
|---|---|
| Synonym | More Synonyms |
| Description | (S,S)-O,O'-Di-p-toluoyltartaric acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog | |
| In Vitro | 酶抑制剂。卡巴拉汀 USP 相关化合物 A。 |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 626.5±55.0 °C at 760 mmHg |
| Melting Point | 169-171 °C(lit.) |
| Molecular Formula | C20H18O8 |
| Molecular Weight | 386.35 |
| Flash Point | 223.2±25.0 °C |
| Exact Mass | 386.100159 |
| PSA | 127.20000 |
| LogP | 6.74 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | CMIBUZBMZCBCAT-HOTGVXAUSA-N |
| SMILES | Cc1ccc(C(=O)OC(C(=O)O)C(OC(=O)c2ccc(C)cc2)C(=O)O)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2942000000 |
|
~%
Di-p-toluoyl-D-... CAS#:32634-68-7 |
| Literature: EP1586551 A1, ; Page/Page column 8-9 ; |
|
~%
Di-p-toluoyl-D-... CAS#:32634-68-7 |
| Literature: Journal of the Chemical Society, , p. 1926 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Butanedioic acid, 2,3-bis[(4-methylbenzoyl)oxy]-, (2S,3S)- |
| L-di-p-Toluyltartaric acid |
| D-DTTA |
| toluoyl-tartaric acid |
| Di-4-Toluoyl-D-tartaric acid |
| (2S,3S)-(+)-2,3-Bis(4-methylbenzoyloxy)succinic acid |
| Di-p-toluoyl-D-tartaric acid |
| (+)-Di-1,4-toluoyl-D-tartaric acid |
| DI-P-TOTUOYL-D-TARTARIC ACID |
| (2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid |
| Butanedioic acid, 2,3-bis((4-methylbenzoyl)oxy)-, (2S,3S)- |
| Di-p-Toluoyl-D-tartaric |
| D-PTTA |
| 2,3-Di-O-para-toluoy |
| (2S,3S)-2,3-Bis((4-methylbenzoyl)oxy)succinic acid |
| (+)-O,O’-Di-p-toluoyl-D-tartaric Acid |
| (2S,3S)-2,3-Bis[(4-methylbenzoyl)oxy]butanedioic acid |
| (+)-O,O′-Di-p-toluoyl-D-tartaric acid |
| (+)-O,O'-Di-p-toluoyl-D-tartaric Acid |
| EINECS 251-132-2 |
| MFCD00008552 |
| (+)-Di-p-toluoyl-D-tartaric Acid |
| di-O,O'-p-toluyl-L-tartaric acid |
| (+)-O,O`-Di-p-toluoyl-D-tartaric Acid |